Mol:LBF18203HP02

From Jcbl.jp
Jump to: navigation, search

LBF18203HP02.png

 
 
Copyright: ARM project http://www.metabolome.jp/ 
 25 25  0  0  0  0  0  0  0  0999 V2000 
    3.2183   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.5038    0.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.7893   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.0773   -0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.3654   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.3466   -0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.0586   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.7344    0.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.3933   -0.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.1247   -1.2150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.2998   -1.2007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    3.9328    0.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    4.6472   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    5.3617    0.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    6.0762   -0.4117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    6.7907    0.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    5.3617    0.8258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.1078   -0.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.8223   -0.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.5367   -0.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -5.3617   -0.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -6.0762   -0.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -6.7907   -0.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.1078    0.8025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.3933    1.2150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
  1  2  1  0 
  2  3  1  0 
  3  4  1  0 
  4  5  1  0 
  5  6  2  0 
  6  7  1  0 
  7  8  1  0 
  8  9  1  0 
  9 10  1  0 
 10 11  1  0 
 11  7  1  0 
  1 12  1  0 
 12 13  1  0 
 13 14  1  0 
 14 15  1  0 
 15 16  1  0 
 14 17  2  0 
  9 18  1  0 
 18 19  1  0 
 19 20  1  0 
 20 21  2  0 
 21 22  1  0 
 22 23  1  0 
 18 24  1  0 
 24 25  1  0 
S  SKP  6 
ID	LBF18203HP02 
FORMULA	C19H32O6 
EXACTMASS	356.219888756 
AVERAGEMASS	356.45378 
SMILES	C(O1)(CC(C=CCCCCCCC(=O)OC)O1)C(OO)CC=CCC 
AUTODRAW	FALSE 
M  END
Personal tools