LBF20207PG25

From lipidbank_wiki
LipidBank Top
(トップ)
Fatty acid
(脂肪酸)
Glycerolipid
(グリセロ脂質)
Sphingolipid
(スフィンゴ脂質)
Journals
(雑誌一覧)
How to edit
(ページの書き方)


Upper classes: LB LBF



{{#lua:
 replacements = {
 ["alpha"] = "α",
 ["beta"] = "β",
 ["chi"]  = "χ",
 ["delta"] = "δ",
 ["Delta"] = "Δ",
 ["epsilon"] = "ε",
 ["zeta"] = "ζ",
 ["phi"] = "φ",
 ["gamma"] = "γ",
 ["Gamma"] = "Γ",
 ["eta"] = "η",
 ["kappa"] = "κ",
 ["lambda"] = "λ", 
 ["mu"] = "μ", 
 ["nu"] = "ν", 
 ["pi"] = "π",
 ["Pi"] = "Π",
 ["theta"] = "θ",
 ["tau"] = "τ",
 ["upsilon"] = "υ",
 ["Upsilon"] = "Υ",
 ["phi"] = "φ",
 ["psi"] = "ψ",
 ["xi"] = "ξ",
 ["omega"] = "ω",
 ["sigma"] = "σ",
 }
 if string.len(stdin) > 0 then
   name = stdin:match(".+")

---SUPER AND SUBSCRIPTS (SINGLE LETTER)---

   name = string.gsub( name, "%^([-+%p%w])_([-+%p%w]) ", '%1
%2
  ')

---SUPER AND SUBSCRIPTS (MULTIPLE LETTERS)---

   name = string.gsub( name, "%^{([-+%p%w]+)}_{([-+%p%w]+)}", '%1
%2
  ')

---SINGLE AND MULTIPLE---

   name = string.gsub( name, "%^([-+%p%w])_{([-+%p%w]+)}", '%1
%2
  ') name = string.gsub( name, "%^{([-+%p%w]+)}_([-+%p%w])", '%1
%2
  ')

---SUPER/SUBSCRIPTS---

   name = string.gsub( name, "_{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "_([-+%p%w]) ", "%1" )
   name = string.gsub( name, "_([-+%p%w])$", "%1" )
   name = string.gsub( name, "%^{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "%^([-+%p%w]) ", "%1" )

---GREEK LETTERS---

   name = string.gsub (name, '([%a"]+)', 
   function (str)
     return replacements[str] or str
   end
   )
 else
   name = ""
 end
 print(name)
Prostaglandin F_2 alpha}}
LBF20207PG25.png
Structural Information
SysName Systematic Name {{#lua:
 replacements = {
 ["alpha"] = "α",
 ["beta"] = "β",
 ["chi"]  = "χ",
 ["delta"] = "δ",
 ["Delta"] = "Δ",
 ["epsilon"] = "ε",
 ["zeta"] = "ζ",
 ["phi"] = "φ",
 ["gamma"] = "γ",
 ["Gamma"] = "Γ",
 ["eta"] = "η",
 ["kappa"] = "κ",
 ["lambda"] = "λ", 
 ["mu"] = "μ", 
 ["nu"] = "ν", 
 ["pi"] = "π",
 ["Pi"] = "Π",
 ["theta"] = "θ",
 ["tau"] = "τ",
 ["upsilon"] = "υ",
 ["Upsilon"] = "Υ",
 ["phi"] = "φ",
 ["psi"] = "ψ",
 ["xi"] = "ξ",
 ["omega"] = "ω",
 ["sigma"] = "σ",
 }
 if string.len(stdin) > 0 then
   name = stdin:match(".+")

---SUPER AND SUBSCRIPTS (SINGLE LETTER)---

   name = string.gsub( name, "%^([-+%p%w])_([-+%p%w]) ", '%1
%2
  ')

---SUPER AND SUBSCRIPTS (MULTIPLE LETTERS)---

   name = string.gsub( name, "%^{([-+%p%w]+)}_{([-+%p%w]+)}", '%1
%2
  ')

---SINGLE AND MULTIPLE---

   name = string.gsub( name, "%^([-+%p%w])_{([-+%p%w]+)}", '%1
%2
  ') name = string.gsub( name, "%^{([-+%p%w]+)}_([-+%p%w])", '%1
%2
  ')

---SUPER/SUBSCRIPTS---

   name = string.gsub( name, "_{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "_([-+%p%w]) ", "%1" )
   name = string.gsub( name, "_([-+%p%w])$", "%1" )
   name = string.gsub( name, "%^{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "%^([-+%p%w]) ", "%1" )

---GREEK LETTERS---

   name = string.gsub (name, '([%a"]+)', 
   function (str)
     return replacements[str] or str
   end
   )
 else
   name = ""
 end
 print(name)
7- [ (3R,5S) -Dihydroxy-2R - (3S -hydroxy-trans-1-octenyl) cyclopentan-1R -yl] -cis-5-heptenoic acid}}
Common Common Name

Template:Metabolite/NameList

Symbol Symbol PGF2α
Formula C20H34O5
Exact Mass 354.240624198
Average Mass 354.48096000000004
SMILES C(CC[C@@H](O)C=C[C@H]([C@H]1CC=CCCCC(O)=O)[C@@H](C[C@@H]1O)O)CC
Physicochemical Information
Melting Melting Point 25-35°C Bundy_GL et al.
Boiling Boiling Point
Density Density
Optical Optical Rotation {{#lua:
 replacements = {
 ["alpha"] = "α",
 ["beta"] = "β",
 ["chi"]  = "χ",
 ["delta"] = "δ",
 ["Delta"] = "Δ",
 ["epsilon"] = "ε",
 ["zeta"] = "ζ",
 ["phi"] = "φ",
 ["gamma"] = "γ",
 ["Gamma"] = "Γ",
 ["eta"] = "η",
 ["kappa"] = "κ",
 ["lambda"] = "λ", 
 ["mu"] = "μ", 
 ["nu"] = "ν", 
 ["pi"] = "π",
 ["Pi"] = "Π",
 ["theta"] = "θ",
 ["tau"] = "τ",
 ["upsilon"] = "υ",
 ["Upsilon"] = "Υ",
 ["phi"] = "φ",
 ["psi"] = "ψ",
 ["xi"] = "ξ",
 ["omega"] = "ω",
 ["sigma"] = "σ",
 }
 if string.len(stdin) > 0 then
   name = stdin:match(".+")

---SUPER AND SUBSCRIPTS (SINGLE LETTER)---

   name = string.gsub( name, "%^([-+%p%w])_([-+%p%w]) ", '%1
%2
  ')

---SUPER AND SUBSCRIPTS (MULTIPLE LETTERS)---

   name = string.gsub( name, "%^{([-+%p%w]+)}_{([-+%p%w]+)}", '%1
%2
  ')

---SINGLE AND MULTIPLE---

   name = string.gsub( name, "%^([-+%p%w])_{([-+%p%w]+)}", '%1
%2
  ') name = string.gsub( name, "%^{([-+%p%w]+)}_([-+%p%w])", '%1
%2
  ')

---SUPER/SUBSCRIPTS---

   name = string.gsub( name, "_{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "_([-+%p%w]) ", "%1" )
   name = string.gsub( name, "_([-+%p%w])$", "%1" )
   name = string.gsub( name, "%^{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "%^([-+%p%w]) ", "%1" )

---GREEK LETTERS---

   name = string.gsub (name, '([%a"]+)', 
   function (str)
     return replacements[str] or str
   end
   )
 else
   name = ""
 end
 print(name)
[ alpha ]^{25}_D =23.8 °(C=1,THF) Corey_EJ et al.}}
Refractive Refractive Index
Solubility Solubility {{#lua:
 replacements = {
 ["alpha"] = "α",
 ["beta"] = "β",
 ["chi"]  = "χ",
 ["delta"] = "δ",
 ["Delta"] = "Δ",
 ["epsilon"] = "ε",
 ["zeta"] = "ζ",
 ["phi"] = "φ",
 ["gamma"] = "γ",
 ["Gamma"] = "Γ",
 ["eta"] = "η",
 ["kappa"] = "κ",
 ["lambda"] = "λ", 
 ["mu"] = "μ", 
 ["nu"] = "ν", 
 ["pi"] = "π",
 ["Pi"] = "Π",
 ["theta"] = "θ",
 ["tau"] = "τ",
 ["upsilon"] = "υ",
 ["Upsilon"] = "Υ",
 ["phi"] = "φ",
 ["psi"] = "ψ",
 ["xi"] = "ξ",
 ["omega"] = "ω",
 ["sigma"] = "σ",
 }
 if string.len(stdin) > 0 then
   name = stdin:match(".+")

---SUPER AND SUBSCRIPTS (SINGLE LETTER)---

   name = string.gsub( name, "%^([-+%p%w])_([-+%p%w]) ", '%1
%2
  ')

---SUPER AND SUBSCRIPTS (MULTIPLE LETTERS)---

   name = string.gsub( name, "%^{([-+%p%w]+)}_{([-+%p%w]+)}", '%1
%2
  ')

---SINGLE AND MULTIPLE---

   name = string.gsub( name, "%^([-+%p%w])_{([-+%p%w]+)}", '%1
%2
  ') name = string.gsub( name, "%^{([-+%p%w]+)}_([-+%p%w])", '%1
%2
  ')

---SUPER/SUBSCRIPTS---

   name = string.gsub( name, "_{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "_([-+%p%w]) ", "%1" )
   name = string.gsub( name, "_([-+%p%w])$", "%1" )
   name = string.gsub( name, "%^{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "%^([-+%p%w]) ", "%1" )

---GREEK LETTERS---

   name = string.gsub (name, '([%a"]+)', 
   function (str)
     return replacements[str] or str
   end
   )
 else
   name = ""
 end
 print(name)
ETHYL ACETATE, ACETONE, DIETHYLETHER Pike_JE et al.. STABILITIES: to be stable under neutral and basic conditions Karim_SM et al.}}
Source Source Prostaglandin F2 alpha was found to be accummulating in human semen in an amount of about 2 microgram per ml Bergstrom_S . In most animal tissues prostanoids are synthesized enzymatically de novo upon physiological and pathological stimulations, and this is also the case of prostaglandin F2 alpha .
Chemical_Synthesis Chemical Synthesis Corey_EJ et al.
LBF20207PG25FT0001.gif
Metabolism Metabolism Prostaglandin F synthase reduces 9,11-endoperoxide of prostaglandin H2 requiring NADPH, and produces prostaglandin F2 alpha . The same enzyme also reduces 9-keto group of prostaglandin D2 producing 11 beta -prostaglandin F2 Urade_Y et al..
Biological_Activity Biological Activity Prostaglandin F2 alpha exhibits various biological activities such as uterine contraction, gastrointestinal contraction, bronchoconstriction, luteolysis and vasoconstriction Bergstrom_S et al.. Prostaglandin F2 alpha is a ligand to a receptor (FP) present in the cell membrane Negishi_M et al..
Genetic_Information Genetic Information cDNA for prostaglandin F synthase was cloned from bovine lung Urade_Y et al.. cDNA for prostaglandin F2 alpha receptor (FP) was cloned, and its 7ptransmembrane structure was reported Negishi_M et al..
Note Note
Spectral Information
Mass Spectra {{#lua:
 replacements = {
 ["alpha"] = "α",
 ["beta"] = "β",
 ["chi"]  = "χ",
 ["delta"] = "δ",
 ["Delta"] = "Δ",
 ["epsilon"] = "ε",
 ["zeta"] = "ζ",
 ["phi"] = "φ",
 ["gamma"] = "γ",
 ["Gamma"] = "Γ",
 ["eta"] = "η",
 ["kappa"] = "κ",
 ["lambda"] = "λ", 
 ["mu"] = "μ", 
 ["nu"] = "ν", 
 ["pi"] = "π",
 ["Pi"] = "Π",
 ["theta"] = "θ",
 ["tau"] = "τ",
 ["upsilon"] = "υ",
 ["Upsilon"] = "Υ",
 ["phi"] = "φ",
 ["psi"] = "ψ",
 ["xi"] = "ξ",
 ["omega"] = "ω",
 ["sigma"] = "σ",
 }
 if string.len(stdin) > 0 then
   name = stdin:match(".+")

---SUPER AND SUBSCRIPTS (SINGLE LETTER)---

   name = string.gsub( name, "%^([-+%p%w])_([-+%p%w]) ", '%1
%2
  ')

---SUPER AND SUBSCRIPTS (MULTIPLE LETTERS)---

   name = string.gsub( name, "%^{([-+%p%w]+)}_{([-+%p%w]+)}", '%1
%2
  ')

---SINGLE AND MULTIPLE---

   name = string.gsub( name, "%^([-+%p%w])_{([-+%p%w]+)}", '%1
%2
  ') name = string.gsub( name, "%^{([-+%p%w]+)}_([-+%p%w])", '%1
%2
  ')

---SUPER/SUBSCRIPTS---

   name = string.gsub( name, "_{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "_([-+%p%w]) ", "%1" )
   name = string.gsub( name, "_([-+%p%w])$", "%1" )
   name = string.gsub( name, "%^{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "%^([-+%p%w]) ", "%1" )

---GREEK LETTERS---

   name = string.gsub (name, '([%a"]+)', 
   function (str)
     return replacements[str] or str
   end
   )
 else
   name = ""
 end
 print(name)
354(M^+ ), 336, 318, 292, 274, 264(100), 247, 229, 191, 177, 165, 137, 99, 81, 67 Horvath_G }}
UV Spectra
IR Spectra {{#lua:
 replacements = {
 ["alpha"] = "α",
 ["beta"] = "β",
 ["chi"]  = "χ",
 ["delta"] = "δ",
 ["Delta"] = "Δ",
 ["epsilon"] = "ε",
 ["zeta"] = "ζ",
 ["phi"] = "φ",
 ["gamma"] = "γ",
 ["Gamma"] = "Γ",
 ["eta"] = "η",
 ["kappa"] = "κ",
 ["lambda"] = "λ", 
 ["mu"] = "μ", 
 ["nu"] = "ν", 
 ["pi"] = "π",
 ["Pi"] = "Π",
 ["theta"] = "θ",
 ["tau"] = "τ",
 ["upsilon"] = "υ",
 ["Upsilon"] = "Υ",
 ["phi"] = "φ",
 ["psi"] = "ψ",
 ["xi"] = "ξ",
 ["omega"] = "ω",
 ["sigma"] = "σ",
 }
 if string.len(stdin) > 0 then
   name = stdin:match(".+")

---SUPER AND SUBSCRIPTS (SINGLE LETTER)---

   name = string.gsub( name, "%^([-+%p%w])_([-+%p%w]) ", '%1
%2
  ')

---SUPER AND SUBSCRIPTS (MULTIPLE LETTERS)---

   name = string.gsub( name, "%^{([-+%p%w]+)}_{([-+%p%w]+)}", '%1
%2
  ')

---SINGLE AND MULTIPLE---

   name = string.gsub( name, "%^([-+%p%w])_{([-+%p%w]+)}", '%1
%2
  ') name = string.gsub( name, "%^{([-+%p%w]+)}_([-+%p%w])", '%1
%2
  ')

---SUPER/SUBSCRIPTS---

   name = string.gsub( name, "_{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "_([-+%p%w]) ", "%1" )
   name = string.gsub( name, "_([-+%p%w])$", "%1" )
   name = string.gsub( name, "%^{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "%^([-+%p%w]) ", "%1" )

---GREEK LETTERS---

   name = string.gsub (name, '([%a"]+)', 
   function (str)
     return replacements[str] or str
   end
   )
 else
   name = ""
 end
 print(name)
NEAT : 3320, 2640, 1710, 1295, 1260, 1245, 1120, 1080, 1055, 1025, 975cm^{-1} PikeJ_E et al. }}
NMR Spectra {{#lua:
 replacements = {
 ["alpha"] = "α",
 ["beta"] = "β",
 ["chi"]  = "χ",
 ["delta"] = "δ",
 ["Delta"] = "Δ",
 ["epsilon"] = "ε",
 ["zeta"] = "ζ",
 ["phi"] = "φ",
 ["gamma"] = "γ",
 ["Gamma"] = "Γ",
 ["eta"] = "η",
 ["kappa"] = "κ",
 ["lambda"] = "λ", 
 ["mu"] = "μ", 
 ["nu"] = "ν", 
 ["pi"] = "π",
 ["Pi"] = "Π",
 ["theta"] = "θ",
 ["tau"] = "τ",
 ["upsilon"] = "υ",
 ["Upsilon"] = "Υ",
 ["phi"] = "φ",
 ["psi"] = "ψ",
 ["xi"] = "ξ",
 ["omega"] = "ω",
 ["sigma"] = "σ",
 }
 if string.len(stdin) > 0 then
   name = stdin:match(".+")

---SUPER AND SUBSCRIPTS (SINGLE LETTER)---

   name = string.gsub( name, "%^([-+%p%w])_([-+%p%w]) ", '%1
%2
  ')

---SUPER AND SUBSCRIPTS (MULTIPLE LETTERS)---

   name = string.gsub( name, "%^{([-+%p%w]+)}_{([-+%p%w]+)}", '%1
%2
  ')

---SINGLE AND MULTIPLE---

   name = string.gsub( name, "%^([-+%p%w])_{([-+%p%w]+)}", '%1
%2
  ') name = string.gsub( name, "%^{([-+%p%w]+)}_([-+%p%w])", '%1
%2
  ')

---SUPER/SUBSCRIPTS---

   name = string.gsub( name, "_{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "_([-+%p%w]) ", "%1" )
   name = string.gsub( name, "_([-+%p%w])$", "%1" )
   name = string.gsub( name, "%^{([-+%p%w]+)}", "%1" )
   name = string.gsub( name, "%^([-+%p%w]) ", "%1" )

---GREEK LETTERS---

   name = string.gsub (name, '([%a"]+)', 
   function (str)
     return replacements[str] or str
   end
   )
 else
   name = ""
 end
 print(name)
^1 H-NMR(d_6 -ACETONE) : delta 5.48(m, 4H), 4.05(m, 3H), 0.9(t, 3H, 20-CH3) Pike_JE et al.. ^{13}C-NMR : 176.6(C1), 135.0(C14), 132.8(C5), 129.1(C13 or C6), 128.9(C6 or C13), 77.2(C11), 72.9(C15), 71.8(C9), 55.0(C12), 49.9(C8), 42,6(C10), 36.8(C16), 33.2(C2), 31,5(C18), 26.3(C4), 25.1(C7), 25.1(C17), 24.5 Lukacs_G et al. }}
Other Spectra
Chromatograms

{{#deftemp:Row2|((#cr:))((#Bar:))- valign="top" ((#cr:))((#bar:))((#nth:(((1)))|2|&&)) ((#Bar:))((#Bar:))3|&&)) ((#Bar:))((#Bar:))((#nth:((#SearchLine: Common Name=||((#nth:(((1)))|3|&&)) ))|3|&&)) ((#Bar:)) style="text-align:center" ((#Bar:))This page ((#Bar:))((#Bar:)) ((#nth:(((1)))|4|&&)) }}

{{#deftemp:Row3|((#cr:))((#bar:))- valign="top" ((#cr:))((#bar:)) ((#nth:(((1)))|3|&&)) ((#bar:))((#bar:))4|&&)) ((#bar:)) style="text-align:center" ((#bar:))((#ifeq:((#nth:(((1)))|4|&&))|((PAGENAME))|See above.|((#forcedbr:((#nth:((#SearchLine:Common Name=||((#nth:(((1)))|4|&&)) ))|3|&&)) )) )) ((#bar:))((#bar:))2|&&))|((RelationTable/GetFirstAuthor|((#car:((#nth:(((1)))|2|&&))|,)) )) ((#nth:((#nth:(((1)))|2|&&))|3|,)) ((#bar:))((#bar:)) ((#nth:(((1)))|5|&&)) }}

Reported Metabolites, References
Template:Row3Template:Row3Template:Row3Template:Row3Template:Row3Template:Row3Template:Row3Template:Row3Template:Row3Template:Row3
Biospecies ID Compound Name Reference Comment



Personal tools