https://lipidbank.jp/mediawiki/index.php?action=history&feed=atom&title=Mol%3AEEL0140 2026-05-09T20:29:14Z Revision history for this page on the wiki MediaWiki 1.43.0 https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0140&diff=77700&oldid=prev 2013-07-12T07:48:28Z

<p>Yoshimoto moved page <a href="/wiki/Mol:LBGAUB0N03" class="mw-redirect" title="Mol:LBGAUB0N03">Mol:LBGAUB0N03</a> to <a href="/wiki/Mol:EEL0140" title="Mol:EEL0140">Mol:EEL0140</a></p> <table style="background-color: #fff; color: #202122;" data-mw="interface"> <col class="diff-marker" /> <col class="diff-content" /> <col class="diff-marker" /> <col class="diff-content" /> <tr class="diff-title" lang="en"> <td colspan="2" style="background-color: #fff; color: #202122; text-align: center;">← Older revision</td> <td colspan="2" style="background-color: #fff; color: #202122; text-align: center;">Revision as of 16:48, 12 July 2013</td> </tr><tr><td colspan="4" class="diff-notice" lang="en"><div class="mw-diff-empty">(No difference)</div> </td></tr> <!-- diff cache key wikidb:diff:1.41:old-77698:rev-77700 --> </table>

Yoshimoto https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0140&diff=77698&oldid=prev 2013-07-12T07:48:09Z

<p>Yoshimoto moved page <a href="/wiki/Mol:EEL0140" title="Mol:EEL0140">Mol:EEL0140</a> to <a href="/wiki/Mol:LBGAUB0N03" class="mw-redirect" title="Mol:LBGAUB0N03">Mol:LBGAUB0N03</a></p> <table style="background-color: #fff; color: #202122;" data-mw="interface"> <col class="diff-marker" /> <col class="diff-content" /> <col class="diff-marker" /> <col class="diff-content" /> <tr class="diff-title" lang="en"> <td colspan="2" style="background-color: #fff; color: #202122; text-align: center;">← Older revision</td> <td colspan="2" style="background-color: #fff; color: #202122; text-align: center;">Revision as of 16:48, 12 July 2013</td> </tr><tr><td colspan="4" class="diff-notice" lang="en"><div class="mw-diff-empty">(No difference)</div> </td></tr> <!-- diff cache key wikidb:diff:1.41:old-71075:rev-77698 --> </table>

Yoshimoto https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0140&diff=71075&oldid=prev 2012-05-11T23:03:54Z

<p>New page: Copyright: ARM project http://www.metabolome.jp/ 47 46 0 0 0 0 0 0 0 0999 V2000 -5.8833 -2.1700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3525 -1.4132 ...</p> <p><b>New page</b></p><div> <br /> <br /> Copyright: ARM project http://www.metabolome.jp/ <br /> 47 46 0 0 0 0 0 0 0 0999 V2000 <br /> -5.8833 -2.1700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -6.3525 -1.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -5.9336 -0.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -6.4027 0.1294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -5.9837 0.9152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -5.1476 -1.0479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -5.1768 -0.1565 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -4.9242 1.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -4.2096 0.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -3.4954 1.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -2.7810 0.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -2.0665 1.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -1.3522 0.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -0.6377 1.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 0.0766 0.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 0.7912 1.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 1.5056 0.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 2.2199 1.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 2.9343 0.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 3.6487 1.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 4.3631 0.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 5.0775 1.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -4.3134 -0.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -3.5990 -0.9930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -2.8846 -0.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -2.1703 -0.9930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -1.4560 -0.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -0.7415 -0.9930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -0.0272 -0.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 0.6874 -0.9930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 1.4018 -0.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 2.1163 -0.9930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 2.8306 -0.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 3.5449 -0.9930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 4.2593 -0.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 4.9738 -0.9930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 5.6882 -0.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -3.4954 2.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -0.6377 2.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 2.2199 2.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 5.0775 2.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -2.8846 0.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> -0.0272 0.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 2.8306 0.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 5.6882 0.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 5.7920 0.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 6.4027 -0.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 <br /> 1 2 1 0 <br /> 2 3 1 0 <br /> 3 4 1 0 <br /> 4 5 1 0 <br /> 3 7 1 0 <br /> 3 6 1 0 <br /> 8 5 1 0 <br /> 9 8 1 0 <br /> 10 9 1 0 <br /> 11 10 1 0 <br /> 12 11 1 0 <br /> 13 12 1 0 <br /> 14 13 1 0 <br /> 15 14 1 0 <br /> 16 15 1 0 <br /> 17 16 1 0 <br /> 18 17 1 0 <br /> 19 18 1 0 <br /> 20 19 1 0 <br /> 21 20 1 0 <br /> 22 21 1 0 <br /> 24 23 1 0 <br /> 25 24 2 0 <br /> 26 25 1 0 <br /> 27 26 1 0 <br /> 28 27 1 0 <br /> 29 28 1 0 <br /> 30 29 1 0 <br /> 31 30 1 0 <br /> 32 31 1 0 <br /> 33 32 1 0 <br /> 34 33 1 0 <br /> 35 34 1 0 <br /> 36 35 1 0 <br /> 37 36 1 0 <br /> 6 23 1 0 <br /> 10 38 1 0 <br /> 14 39 1 0 <br /> 18 40 1 0 <br /> 22 41 1 0 <br /> 25 42 1 0 <br /> 29 43 1 0 <br /> 33 44 1 0 <br /> 37 45 1 0 <br /> 22 46 1 0 <br /> 37 47 1 0 <br /> S SKP 6 <br /> AUTODRAW FALSE <br /> ID EEL0140 <br /> FORMULA C43H86O3 <br /> EXACTMASS 650.657696618 <br /> AVERAGEMASS 651.14114 <br /> SMILES C(CO)(OCC=C(CCCC(C)CCCC(C)CCCC(C)C)C)(COCCC(C)CCCC(C)CCCC(C)CCCC(C)C)[H] <br /> M END</div>

Editor