<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AEEL0250</id>
	<title>Mol:EEL0250 - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AEEL0250"/>
	<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;action=history"/>
	<updated>2026-07-09T21:50:23Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;diff=76295&amp;oldid=prev</id>
		<title>Yoshimoto at 02:59, 5 June 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;diff=76295&amp;oldid=prev"/>
		<updated>2013-06-05T02:59:16Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;a href=&quot;//lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;amp;diff=76295&amp;amp;oldid=76286&quot;&gt;Show changes&lt;/a&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;diff=76286&amp;oldid=prev</id>
		<title>Yoshimoto at 02:41, 5 June 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;diff=76286&amp;oldid=prev"/>
		<updated>2013-06-05T02:41:27Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:41, 5 June 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l216&quot;&gt;Line 216:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 216:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  50 48  1  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  50 48  1  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;107 47  1  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;107 47  1  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL0250  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL0250  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;C89H182O13P2 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;EXACTMASS	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;EXACTMASS	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;1521.3055689300002 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;1522.3371019999997 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;C(CC(C)CCCC(C)C)CC(C)CCCC(C)CCOCC(COP(O)(=O)OCC([H])(O)COP(O)(=O)OCC(COCCC(C)CCCC(C)CCCC(C)CCCC(C)C)([H])OCCC(CCCC(C)CCCC(CCCC(C)C)C)C)([H])OCCC(CCCC(C)CCCC(CCCC(C)C)C)C &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;diff=76283&amp;oldid=prev</id>
		<title>Yoshimoto at 02:40, 5 June 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;diff=76283&amp;oldid=prev"/>
		<updated>2013-06-05T02:40:54Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:40, 5 June 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l216&quot;&gt;Line 216:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 216:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  50 48  1  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  50 48  1  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;107 47  1  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;107 47  1  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-added&quot;&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL0250  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL0250  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;C89H182O13P2 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;EXACTMASS	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;1521.3055689300002 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;EXACTMASS	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;1522.3371019999997 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;C(CC(C)CCCC(C)C)CC(C)CCCC(C)CCOCC(COP(O)(=O)OCC([H])(O)COP(O)(=O)OCC(COCCC(C)CCCC(C)CCCC(C)CCCC(C)C)([H])OCCC(CCCC(C)CCCC(CCCC(C)C)C)C)([H])OCCC(CCCC(C)CCCC(CCCC(C)C)C)C &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;diff=71149&amp;oldid=prev</id>
		<title>Editor: New page:     Copyright: ARM project http://www.metabolome.jp/  107106  0  0  0  0  0  0  0  0999 V2000     -4.1642    2.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0     -4.5531    3.6082  ...</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL0250&amp;diff=71149&amp;oldid=prev"/>
		<updated>2012-05-11T15:23:54Z</updated>

		<summary type="html">&lt;p&gt;New page:     Copyright: ARM project http://www.metabolome.jp/  107106  0  0  0  0  0  0  0  0999 V2000     -4.1642    2.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0     -4.5531    3.6082  ...&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
107106  0  0  0  0  0  0  0  0999 V2000 &lt;br /&gt;
   -4.1642    2.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.5531    3.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.8938    4.3939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.9777    2.4309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.1671    3.4026    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.7542    4.1654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1196    4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.4055    4.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6911    4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0233    4.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7376    4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4522    4.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.1664    4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.8810    4.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.5953    4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3098    4.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0241    4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7385    4.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.4528    4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.1673    4.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1433    1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.5091    2.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.7947    1.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.0805    2.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.6339    1.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.3484    2.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.0627    1.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.7772    2.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.4915    1.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.2062    2.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.9204    1.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.6347    2.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.3490    1.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.0636    2.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.7780    1.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.4055    3.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4522    3.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3098    3.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.1673    3.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.7947    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.0627    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.9204    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.7780    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.8818    4.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.4925    2.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.3270   -3.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.9970   -2.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.7595   -2.3939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3645   -4.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.9115   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.1970   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.4826   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.2317   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.9462   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.6604   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.3749   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.0893   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.8038   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.5182   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.2324   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.9468   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.6613   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.3757   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.0901   -1.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.4008   -4.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.6861   -4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.9719   -4.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.2576   -4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.4566   -4.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.1711   -4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.8855   -4.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.6001   -4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.3144   -4.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.0288   -4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.7431   -4.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.4575   -4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.1719   -4.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.8864   -4.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.6007   -4.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.4826   -1.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.3749   -1.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.2324   -1.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.0901   -1.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.9719   -3.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.8855   -3.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.7431   -3.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.6007   -3.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.8045   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.3151   -4.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.6795    1.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.5045    1.3618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.3295    1.3618    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.3295    0.5368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.3295    2.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.1545    1.3618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.9795    1.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.9795    0.1243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.9795   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.1545    0.1243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.8045    0.1243    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.1545   -1.0307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.3295   -1.0307    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.3295   -1.8557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.5045   -1.0307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.5420   -1.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.3295   -0.2057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3046   -3.3074    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0 &lt;br /&gt;
  2  3  1  0 &lt;br /&gt;
  1  5  1  0 &lt;br /&gt;
  1  4  1  0 &lt;br /&gt;
  6  3  1  0 &lt;br /&gt;
  7  6  1  0 &lt;br /&gt;
  8  7  1  0 &lt;br /&gt;
  9  8  1  0 &lt;br /&gt;
 10  9  1  0 &lt;br /&gt;
 11 10  1  0 &lt;br /&gt;
 12 11  1  0 &lt;br /&gt;
 13 12  1  0 &lt;br /&gt;
 14 13  1  0 &lt;br /&gt;
 15 14  1  0 &lt;br /&gt;
 16 15  1  0 &lt;br /&gt;
 17 16  1  0 &lt;br /&gt;
 18 17  1  0 &lt;br /&gt;
 19 18  1  0 &lt;br /&gt;
 20 19  1  0 &lt;br /&gt;
 22 21  1  0 &lt;br /&gt;
 23 22  1  0 &lt;br /&gt;
 24 23  1  0 &lt;br /&gt;
 25 24  1  0 &lt;br /&gt;
 26 25  1  0 &lt;br /&gt;
 27 26  1  0 &lt;br /&gt;
 28 27  1  0 &lt;br /&gt;
 29 28  1  0 &lt;br /&gt;
 30 29  1  0 &lt;br /&gt;
 31 30  1  0 &lt;br /&gt;
 32 31  1  0 &lt;br /&gt;
 33 32  1  0 &lt;br /&gt;
 34 33  1  0 &lt;br /&gt;
 35 34  1  0 &lt;br /&gt;
  4 21  1  0 &lt;br /&gt;
  8 36  1  0 &lt;br /&gt;
 12 37  1  0 &lt;br /&gt;
 16 38  1  0 &lt;br /&gt;
 20 39  1  0 &lt;br /&gt;
 23 40  1  0 &lt;br /&gt;
 27 41  1  0 &lt;br /&gt;
 31 42  1  0 &lt;br /&gt;
 35 43  1  0 &lt;br /&gt;
 20 44  1  0 &lt;br /&gt;
 35 45  1  0 &lt;br /&gt;
 46 47  1  0 &lt;br /&gt;
 47 48  1  0 &lt;br /&gt;
 46 49  1  0 &lt;br /&gt;
 51 50  1  0 &lt;br /&gt;
 52 51  1  0 &lt;br /&gt;
 53 52  1  0 &lt;br /&gt;
 54 53  1  0 &lt;br /&gt;
 55 54  1  0 &lt;br /&gt;
 56 55  1  0 &lt;br /&gt;
 57 56  1  0 &lt;br /&gt;
 58 57  1  0 &lt;br /&gt;
 59 58  1  0 &lt;br /&gt;
 60 59  1  0 &lt;br /&gt;
 61 60  1  0 &lt;br /&gt;
 62 61  1  0 &lt;br /&gt;
 63 62  1  0 &lt;br /&gt;
 64 63  1  0 &lt;br /&gt;
 66 65  1  0 &lt;br /&gt;
 67 66  1  0 &lt;br /&gt;
 68 67  1  0 &lt;br /&gt;
 69 68  1  0 &lt;br /&gt;
 70 69  1  0 &lt;br /&gt;
 71 70  1  0 &lt;br /&gt;
 72 71  1  0 &lt;br /&gt;
 73 72  1  0 &lt;br /&gt;
 74 73  1  0 &lt;br /&gt;
 75 74  1  0 &lt;br /&gt;
 76 75  1  0 &lt;br /&gt;
 77 76  1  0 &lt;br /&gt;
 78 77  1  0 &lt;br /&gt;
 79 78  1  0 &lt;br /&gt;
 49 65  1  0 &lt;br /&gt;
 52 80  1  0 &lt;br /&gt;
 56 81  1  0 &lt;br /&gt;
 60 82  1  0 &lt;br /&gt;
 64 83  1  0 &lt;br /&gt;
 67 84  1  0 &lt;br /&gt;
 71 85  1  0 &lt;br /&gt;
 75 86  1  0 &lt;br /&gt;
 79 87  1  0 &lt;br /&gt;
 64 88  1  0 &lt;br /&gt;
 79 89  1  0 &lt;br /&gt;
  1 90  1  0 &lt;br /&gt;
 90 91  1  0 &lt;br /&gt;
 91 92  1  0 &lt;br /&gt;
 92 93  1  0 &lt;br /&gt;
 92 94  2  0 &lt;br /&gt;
 92 95  1  0 &lt;br /&gt;
 95 96  1  0 &lt;br /&gt;
 96 97  1  0 &lt;br /&gt;
 97 98  1  0 &lt;br /&gt;
 97 99  1  0 &lt;br /&gt;
 97100  1  0 &lt;br /&gt;
 98101  1  0 &lt;br /&gt;
101102  1  0 &lt;br /&gt;
102103  1  0 &lt;br /&gt;
102104  1  0 &lt;br /&gt;
104105  1  0 &lt;br /&gt;
102106  2  0 &lt;br /&gt;
 47105  1  0 &lt;br /&gt;
 50 48  1  0 &lt;br /&gt;
107 47  1  0 &lt;br /&gt;
S  SKP  6 &lt;br /&gt;
AUTODRAW	FALSE &lt;br /&gt;
ID	EEL0250 &lt;br /&gt;
FORMULA	C89H182O13P2 &lt;br /&gt;
EXACTMASS	1521.3055689300002 &lt;br /&gt;
AVERAGEMASS	1522.3371019999997 &lt;br /&gt;
SMILES	C(CC(C)CCCC(C)C)CC(C)CCCC(C)CCOCC(COP(O)(=O)OCC([H])(O)COP(O)(=O)OCC(COCCC(C)CCCC(C)CCCC(C)CCCC(C)C)([H])OCCC(CCCC(C)CCCC(CCCC(C)C)C)C)([H])OCCC(CCCC(C)CCCC(CCCC(C)C)C)C &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
</feed>