<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AEEL1025</id>
	<title>Mol:EEL1025 - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AEEL1025"/>
	<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;action=history"/>
	<updated>2026-10-02T10:03:44Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77451&amp;oldid=prev</id>
		<title>Yoshimoto: Yoshimoto moved page Mol:LBGADI2G01 to Mol:EEL1025</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77451&amp;oldid=prev"/>
		<updated>2013-07-11T02:02:31Z</updated>

		<summary type="html">&lt;p&gt;Yoshimoto moved page &lt;a href=&quot;/wiki/Mol:LBGADI2G01&quot; class=&quot;mw-redirect&quot; title=&quot;Mol:LBGADI2G01&quot;&gt;Mol:LBGADI2G01&lt;/a&gt; to &lt;a href=&quot;/wiki/Mol:EEL1025&quot; title=&quot;Mol:EEL1025&quot;&gt;Mol:EEL1025&lt;/a&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:02, 11 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;4&quot; class=&quot;diff-notice&quot; lang=&quot;en&quot;&gt;&lt;div class=&quot;mw-diff-empty&quot;&gt;(No difference)&lt;/div&gt;
&lt;/td&gt;&lt;/tr&gt;
&lt;!-- diff cache key wikidb:diff:1.41:old-77449:rev-77451 --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77449&amp;oldid=prev</id>
		<title>Yoshimoto: Yoshimoto moved page Mol:EEL1025 to Mol:LBGADI2G01</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77449&amp;oldid=prev"/>
		<updated>2013-07-11T02:01:58Z</updated>

		<summary type="html">&lt;p&gt;Yoshimoto moved page &lt;a href=&quot;/wiki/Mol:EEL1025&quot; title=&quot;Mol:EEL1025&quot;&gt;Mol:EEL1025&lt;/a&gt; to &lt;a href=&quot;/wiki/Mol:LBGADI2G01&quot; class=&quot;mw-redirect&quot; title=&quot;Mol:LBGADI2G01&quot;&gt;Mol:LBGADI2G01&lt;/a&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:01, 11 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;4&quot; class=&quot;diff-notice&quot; lang=&quot;en&quot;&gt;&lt;div class=&quot;mw-diff-empty&quot;&gt;(No difference)&lt;/div&gt;
&lt;/td&gt;&lt;/tr&gt;
&lt;!-- diff cache key wikidb:diff:1.41:old-77443:rev-77449 --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77443&amp;oldid=prev</id>
		<title>Yoshimoto: Yoshimoto moved page Mol:LBGAAB0N01 to Mol:EEL1025</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77443&amp;oldid=prev"/>
		<updated>2013-07-11T01:58:37Z</updated>

		<summary type="html">&lt;p&gt;Yoshimoto moved page &lt;a href=&quot;/wiki/Mol:LBGAAB0N01&quot; class=&quot;mw-redirect&quot; title=&quot;Mol:LBGAAB0N01&quot;&gt;Mol:LBGAAB0N01&lt;/a&gt; to &lt;a href=&quot;/wiki/Mol:EEL1025&quot; title=&quot;Mol:EEL1025&quot;&gt;Mol:EEL1025&lt;/a&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 10:58, 11 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;4&quot; class=&quot;diff-notice&quot; lang=&quot;en&quot;&gt;&lt;div class=&quot;mw-diff-empty&quot;&gt;(No difference)&lt;/div&gt;
&lt;/td&gt;&lt;/tr&gt;
&lt;!-- diff cache key wikidb:diff:1.41:old-77441:rev-77443 --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77441&amp;oldid=prev</id>
		<title>Yoshimoto: Yoshimoto moved page Mol:EEL1025 to Mol:LBGAAB0N01</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77441&amp;oldid=prev"/>
		<updated>2013-07-11T01:58:04Z</updated>

		<summary type="html">&lt;p&gt;Yoshimoto moved page &lt;a href=&quot;/wiki/Mol:EEL1025&quot; title=&quot;Mol:EEL1025&quot;&gt;Mol:EEL1025&lt;/a&gt; to &lt;a href=&quot;/wiki/Mol:LBGAAB0N01&quot; class=&quot;mw-redirect&quot; title=&quot;Mol:LBGAAB0N01&quot;&gt;Mol:LBGAAB0N01&lt;/a&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 10:58, 11 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;4&quot; class=&quot;diff-notice&quot; lang=&quot;en&quot;&gt;&lt;div class=&quot;mw-diff-empty&quot;&gt;(No difference)&lt;/div&gt;
&lt;/td&gt;&lt;/tr&gt;
&lt;!-- diff cache key wikidb:diff:1.41:old-77414:rev-77441 --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77414&amp;oldid=prev</id>
		<title>Yoshimoto at 08:14, 10 July 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77414&amp;oldid=prev"/>
		<updated>2013-07-10T08:14:40Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 17:14, 10 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l231&quot;&gt;Line 231:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 231:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A  111  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A  111  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Glc  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Glc  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1025  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1025  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-77411:rev-77414:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77411&amp;oldid=prev</id>
		<title>Yoshimoto at 08:13, 10 July 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77411&amp;oldid=prev"/>
		<updated>2013-07-10T08:13:59Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 17:13, 10 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l2&quot;&gt;Line 2:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 2:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Copyright: ARM project http://www.metabolome.jp/  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Copyright: ARM project http://www.metabolome.jp/  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;110112 &lt;/del&gt; 0  0  0  0  0  0  0  0999 V2000  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;111113 &lt;/ins&gt; 0  0  0  0  0  0  0  0999 V2000  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -15.1493   -0.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -15.1493   -0.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -14.4732    0.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -14.4732    0.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l113&quot;&gt;Line 113:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 113:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -11.7827   -2.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -11.7827   -2.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -13.0882   -4.0635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -13.0882   -4.0635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;  -11.7615   -1.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   1  2  1  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   1  2  1  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   2  3  1  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   2  3  1  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l225&quot;&gt;Line 225:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 226:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  94102  1  1  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  94102  1  1  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  94101  1  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  94101  1  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;107111  1  0 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A  100  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A  100  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;A  111 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;Glc &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1025  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1025  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-77150:rev-77411:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77150&amp;oldid=prev</id>
		<title>Yoshimoto at 02:14, 1 July 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77150&amp;oldid=prev"/>
		<updated>2013-07-01T02:14:08Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:14, 1 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l227&quot;&gt;Line 227:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 227:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A  100  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A  100  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1025  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1025  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-77147:rev-77150:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77147&amp;oldid=prev</id>
		<title>Yoshimoto at 02:13, 1 July 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=77147&amp;oldid=prev"/>
		<updated>2013-07-01T02:13:27Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;a href=&quot;//lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;amp;diff=77147&amp;amp;oldid=76379&quot;&gt;Show changes&lt;/a&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=76379&amp;oldid=prev</id>
		<title>Yoshimoto at 08:08, 5 June 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=76379&amp;oldid=prev"/>
		<updated>2013-06-05T08:08:43Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;a href=&quot;//lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;amp;diff=76379&amp;amp;oldid=71181&quot;&gt;Show changes&lt;/a&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=71181&amp;oldid=prev</id>
		<title>Editor: New page:     Copyright: ARM project http://www.metabolome.jp/  111113  0  0  0  0  0  0  0  0999 V2000    -13.4166    0.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0    -12.7405    1.2420  ...</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1025&amp;diff=71181&amp;oldid=prev"/>
		<updated>2012-05-11T14:50:30Z</updated>

		<summary type="html">&lt;p&gt;New page:     Copyright: ARM project http://www.metabolome.jp/  111113  0  0  0  0  0  0  0  0999 V2000    -13.4166    0.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0    -12.7405    1.2420  ...&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
111113  0  0  0  0  0  0  0  0999 V2000 &lt;br /&gt;
  -13.4166    0.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.7405    1.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.8391    2.4892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.7687    3.3136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.5399    0.4431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -10.6289    3.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.9947    3.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.2805    3.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.5661    3.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.8515    3.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.1371    3.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.4227    3.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.7083    3.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.9936    3.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2793    3.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5650    3.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8506    3.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1363    3.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.4218    3.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.7072    3.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -10.8021   -0.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -10.1678    0.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.4534   -0.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.7390    0.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.0245   -0.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.3102    0.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5318   -0.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8175   -0.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1031   -0.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.3885   -0.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6742   -0.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.2805    2.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.4227    2.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5650    2.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.7072    2.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.4534   -1.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5318   -1.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6742   -1.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0071    3.5269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0404   -0.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   13.4166    2.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.8057    1.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   13.1948    0.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.5357   -0.3261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.6190    1.6368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.8086    0.6654    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.3958   -0.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.7616   -0.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.0473   -0.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.3330   -0.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.6183   -0.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.9040   -0.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.1895   -0.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.4752   -0.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7606   -0.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0462   -0.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3319   -0.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.6175   -0.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.9031   -0.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.1887   -0.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4741   -0.1291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.7848    2.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.1506    1.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.4361    2.1934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.7218    1.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.0072    2.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.2930    1.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.2983    3.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.5840    3.0997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.8695    3.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.1549    3.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4406    3.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.0472    0.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.1893    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3318    0.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4739    0.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.4359    3.0356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.2981    4.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4404    4.3540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7598   -0.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7261    3.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.5094   -1.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.5094   -0.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2965   -0.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0320    3.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0320    2.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7458    1.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.4611    2.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.4611    3.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.8024    0.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.0267   -0.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.9679    1.5314    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.9678   -3.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.9464   -3.3852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.6789   -1.6644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.9678   -3.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.9464   -2.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.6789   -2.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.6626   -3.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -10.8115   -1.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.6823   -4.3545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.6626   -3.9597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.9678   -2.4467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -10.8113   -1.1052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.2320   -3.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   13.0924    3.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.2776    3.1502    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.2776    3.9751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.2776    2.3252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.4526    3.1502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.6276    3.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0 &lt;br /&gt;
  2  3  1  0 &lt;br /&gt;
  3  4  1  0 &lt;br /&gt;
  2  5  1  0 &lt;br /&gt;
  6  4  1  0 &lt;br /&gt;
  7  6  1  0 &lt;br /&gt;
  8  7  1  0 &lt;br /&gt;
  9  8  1  0 &lt;br /&gt;
 10  9  1  0 &lt;br /&gt;
 11 10  1  0 &lt;br /&gt;
 12 11  1  0 &lt;br /&gt;
 13 12  1  0 &lt;br /&gt;
 14 13  1  0 &lt;br /&gt;
 15 14  1  0 &lt;br /&gt;
 16 15  1  0 &lt;br /&gt;
 17 16  1  0 &lt;br /&gt;
 18 17  1  0 &lt;br /&gt;
 19 18  1  0 &lt;br /&gt;
 20 19  1  0 &lt;br /&gt;
 22 21  1  0 &lt;br /&gt;
 23 22  1  0 &lt;br /&gt;
 24 23  1  0 &lt;br /&gt;
 25 24  1  0 &lt;br /&gt;
 26 25  1  0 &lt;br /&gt;
 28 27  1  0 &lt;br /&gt;
 29 28  1  0 &lt;br /&gt;
 30 29  1  0 &lt;br /&gt;
 31 30  1  0 &lt;br /&gt;
  5 21  1  0 &lt;br /&gt;
  8 32  1  0 &lt;br /&gt;
 12 33  1  0 &lt;br /&gt;
 16 34  1  0 &lt;br /&gt;
 20 35  1  0 &lt;br /&gt;
 23 36  1  0 &lt;br /&gt;
 27 37  1  0 &lt;br /&gt;
 31 38  1  0 &lt;br /&gt;
 20 39  1  0 &lt;br /&gt;
 31 40  1  0 &lt;br /&gt;
 41 42  1  0 &lt;br /&gt;
 42 43  1  0 &lt;br /&gt;
 43 44  1  0 &lt;br /&gt;
 42 46  1  0 &lt;br /&gt;
 42 45  1  0 &lt;br /&gt;
 47 44  1  0 &lt;br /&gt;
 48 47  1  0 &lt;br /&gt;
 49 48  1  0 &lt;br /&gt;
 50 49  1  0 &lt;br /&gt;
 51 50  1  0 &lt;br /&gt;
 52 51  1  0 &lt;br /&gt;
 53 52  1  0 &lt;br /&gt;
 54 53  1  0 &lt;br /&gt;
 55 54  1  0 &lt;br /&gt;
 56 55  1  0 &lt;br /&gt;
 57 56  1  0 &lt;br /&gt;
 58 57  1  0 &lt;br /&gt;
 59 58  1  0 &lt;br /&gt;
 60 59  1  0 &lt;br /&gt;
 61 60  1  0 &lt;br /&gt;
 63 62  1  0 &lt;br /&gt;
 64 63  1  0 &lt;br /&gt;
 65 64  1  0 &lt;br /&gt;
 66 65  1  0 &lt;br /&gt;
 67 66  1  0 &lt;br /&gt;
 69 68  1  0 &lt;br /&gt;
 70 69  1  0 &lt;br /&gt;
 71 70  1  0 &lt;br /&gt;
 72 71  1  0 &lt;br /&gt;
 45 62  1  0 &lt;br /&gt;
 49 73  1  0 &lt;br /&gt;
 53 74  1  0 &lt;br /&gt;
 57 75  1  0 &lt;br /&gt;
 61 76  1  0 &lt;br /&gt;
 64 77  1  0 &lt;br /&gt;
 68 78  1  0 &lt;br /&gt;
 72 79  1  0 &lt;br /&gt;
 61 80  1  0 &lt;br /&gt;
 72 81  1  0 &lt;br /&gt;
 39 81  1  0 &lt;br /&gt;
 40 80  1  0 &lt;br /&gt;
 82 83  1  0 &lt;br /&gt;
 26 83  1  0 &lt;br /&gt;
 27 84  1  0 &lt;br /&gt;
 85 86  1  0 &lt;br /&gt;
 86 87  1  0 &lt;br /&gt;
 87 88  1  0 &lt;br /&gt;
 88 89  1  0 &lt;br /&gt;
 85 89  1  0 &lt;br /&gt;
 68 85  1  0 &lt;br /&gt;
 67 88  1  0 &lt;br /&gt;
 83 90  1  0 &lt;br /&gt;
 84 91  1  0 &lt;br /&gt;
 91 90  1  0 &lt;br /&gt;
  2 92  1  0 &lt;br /&gt;
 99 93  1  1 &lt;br /&gt;
 98 93  1  1 &lt;br /&gt;
 97 99  1  1 &lt;br /&gt;
 97 94  1  0 &lt;br /&gt;
 98 95  1  0 &lt;br /&gt;
 93 96  1  0 &lt;br /&gt;
100 97  1  0 &lt;br /&gt;
 98100  1  0 &lt;br /&gt;
 96101  1  0 &lt;br /&gt;
 99102  1  0 &lt;br /&gt;
 93103  1  0 &lt;br /&gt;
 95  1  1  0 &lt;br /&gt;
100104  1  0 &lt;br /&gt;
 94105  1  0 &lt;br /&gt;
106107  1  0 &lt;br /&gt;
107108  2  0 &lt;br /&gt;
107109  1  0 &lt;br /&gt;
107110  1  0 &lt;br /&gt;
110111  1  0 &lt;br /&gt;
 41106  1  0 &lt;br /&gt;
A  105 &lt;br /&gt;
Glc &lt;br /&gt;
A  111 &lt;br /&gt;
Ino &lt;br /&gt;
S  SKP  6 &lt;br /&gt;
AUTODRAW	FALSE &lt;br /&gt;
ID	EEL1025 &lt;br /&gt;
FORMULA	C94H185O14P &lt;br /&gt;
EXACTMASS	1569.3501971379999 &lt;br /&gt;
AVERAGEMASS	1570.440061 &lt;br /&gt;
SMILES	O(P(OC)(O)=O)CC(C2)(OCCC(C)CCCC(C3)CC(C3)C(CCCC(CCC(C)CCCC(C)CCCC(C)CCCC(CCOCC([H])(OCCC(CCCC(C)CCCC(CCCC(CCC(C)CCCC(CCCC(CCCC(C)CCO2)C)C)C)C)C)COC(C(O)1)C(O)(CO)C(O)C1OC)C)C)C)[H] &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
</feed>