<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AEEL1048</id>
	<title>Mol:EEL1048 - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AEEL1048"/>
	<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;action=history"/>
	<updated>2026-08-09T06:10:53Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=75741&amp;oldid=prev</id>
		<title>Editor at 06:48, 30 April 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=75741&amp;oldid=prev"/>
		<updated>2013-04-30T06:48:54Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 15:48, 30 April 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l208&quot;&gt;Line 208:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 208:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   99  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   99  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1048  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1048  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C88H175O9P  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C88H175O9P  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-75738:rev-75741:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=75738&amp;oldid=prev</id>
		<title>Editor at 06:48, 30 April 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=75738&amp;oldid=prev"/>
		<updated>2013-04-30T06:48:39Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 15:48, 30 April 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l208&quot;&gt;Line 208:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 208:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   99  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   99  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-added&quot;&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1048  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1048  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;C88H175O9P &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;EXACTMASS	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;EXACTMASS	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;1407.2973737080001 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;1408.299461 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;C(C([H])2COP(O)(=O)OC)OCCC(C)CCCC(CCCC(CCCC(CCC(C)CCCC(CCCC(C)CCCC(C)CCOC([H])(COC)COCCC(C)CCCC(CCCC(C)CCCC(CCC(CCCC(C)C(C1)CC(CCCC(C)CCO2)C1)C)C)C)C)C)C)C &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-75735:rev-75738:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=75735&amp;oldid=prev</id>
		<title>Editor at 06:48, 30 April 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=75735&amp;oldid=prev"/>
		<updated>2013-04-30T06:48:09Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 15:48, 30 April 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l2&quot;&gt;Line 2:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 2:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Copyright: ARM project http://www.metabolome.jp/  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Copyright: ARM project http://www.metabolome.jp/  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;EEL1048.mol &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-added&quot;&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;  ChemDraw04261318113D &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-added&quot;&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-added&quot;&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;100101  0  0  0  0  0  0  0  0999 V2000  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;100101  0  0  0  0  0  0  0  0999 V2000  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -15.0344   -1.1390   -0.1275 C   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   -15.0344   -1.1390   -0.1275 C   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l211&quot;&gt;Line 211:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 208:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   99  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   99  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1048  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	EEL1048  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-75732:rev-75735:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=75732&amp;oldid=prev</id>
		<title>Editor at 06:47, 30 April 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=75732&amp;oldid=prev"/>
		<updated>2013-04-30T06:47:37Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;a href=&quot;//lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;amp;diff=75732&amp;amp;oldid=71204&quot;&gt;Show changes&lt;/a&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=71204&amp;oldid=prev</id>
		<title>Editor: New page:     Copyright: ARM project http://www.metabolome.jp/  100101  0  0  0  0  0  0  0  0999 V2000    -13.4087   -1.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0    -12.7326   -0.2724  ...</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL1048&amp;diff=71204&amp;oldid=prev"/>
		<updated>2012-05-11T13:34:21Z</updated>

		<summary type="html">&lt;p&gt;New page:     Copyright: ARM project http://www.metabolome.jp/  100101  0  0  0  0  0  0  0  0999 V2000    -13.4087   -1.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0    -12.7326   -0.2724  ...&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
100101  0  0  0  0  0  0  0  0999 V2000 &lt;br /&gt;
  -13.4087   -1.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.7326   -0.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.8312    0.9749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.7609    1.7993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.8346   -1.4837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -11.8178   -0.3884    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -10.6210    1.5709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.9868    2.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.2726    1.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.5582    2.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.8436    1.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.1292    2.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.4148    1.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.7004    2.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.9858    1.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2714    2.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5571    1.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8427    2.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.1284    1.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.4139    2.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6993    1.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -10.7942   -1.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -10.1599   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.4455   -1.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.7311   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -8.0166   -1.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -7.3023   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5239   -2.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.8096   -1.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.0952   -2.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.3806   -1.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6663   -2.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.2726    0.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.4148    0.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5571    0.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6993    0.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -9.4455   -2.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5239   -2.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6663   -2.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0150    2.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0483   -1.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.8834   -2.4151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  -12.0938   -3.0397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   13.4087    1.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.8136   -0.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   13.2027   -1.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.5436   -1.8404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.6270    0.1225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.8166   -0.8490    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.4038   -1.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.7695   -2.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.0552   -1.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.3409   -2.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.6262   -1.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.9119   -2.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.1974   -1.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.4831   -2.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7685   -1.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0542   -2.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3398   -1.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.6254   -2.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.9110   -1.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.1966   -2.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4820   -1.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.7927    0.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.1585    0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.4440    0.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.7297    0.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.0151    0.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.3009    0.2663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3062    1.9979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.5919    1.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.8774    1.9977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.1628    1.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4485    1.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.0551   -0.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.1972   -0.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3397   -0.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4818   -0.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.4438    1.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3060    2.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.4483    2.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7677   -2.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7340    1.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   13.1291    2.2092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.5015   -2.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.5015   -1.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2886   -1.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0400    1.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0400    0.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7537    0.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.4690    0.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.4690    1.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.7945   -1.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.0189   -1.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.3143    2.2147    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.3143    3.0397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.3143    1.3897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.4893    2.2147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.6643    2.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0 &lt;br /&gt;
  2  3  1  0 &lt;br /&gt;
  3  4  1  0 &lt;br /&gt;
  2  6  1  0 &lt;br /&gt;
  2  5  1  0 &lt;br /&gt;
  7  4  1  0 &lt;br /&gt;
  8  7  1  0 &lt;br /&gt;
  9  8  1  0 &lt;br /&gt;
 10  9  1  0 &lt;br /&gt;
 11 10  1  0 &lt;br /&gt;
 12 11  1  0 &lt;br /&gt;
 13 12  1  0 &lt;br /&gt;
 14 13  1  0 &lt;br /&gt;
 15 14  1  0 &lt;br /&gt;
 16 15  1  0 &lt;br /&gt;
 17 16  1  0 &lt;br /&gt;
 18 17  1  0 &lt;br /&gt;
 19 18  1  0 &lt;br /&gt;
 20 19  1  0 &lt;br /&gt;
 21 20  1  0 &lt;br /&gt;
 23 22  1  0 &lt;br /&gt;
 24 23  1  0 &lt;br /&gt;
 25 24  1  0 &lt;br /&gt;
 26 25  1  0 &lt;br /&gt;
 27 26  1  0 &lt;br /&gt;
 29 28  1  0 &lt;br /&gt;
 30 29  1  0 &lt;br /&gt;
 31 30  1  0 &lt;br /&gt;
 32 31  1  0 &lt;br /&gt;
  5 22  1  0 &lt;br /&gt;
  9 33  1  0 &lt;br /&gt;
 13 34  1  0 &lt;br /&gt;
 17 35  1  0 &lt;br /&gt;
 21 36  1  0 &lt;br /&gt;
 24 37  1  0 &lt;br /&gt;
 28 38  1  0 &lt;br /&gt;
 32 39  1  0 &lt;br /&gt;
 21 40  1  0 &lt;br /&gt;
 32 41  1  0 &lt;br /&gt;
  1 42  1  0 &lt;br /&gt;
 42 43  1  0 &lt;br /&gt;
 44 45  1  0 &lt;br /&gt;
 45 46  1  0 &lt;br /&gt;
 46 47  1  0 &lt;br /&gt;
 45 49  1  0 &lt;br /&gt;
 45 48  1  0 &lt;br /&gt;
 50 47  1  0 &lt;br /&gt;
 51 50  1  0 &lt;br /&gt;
 52 51  1  0 &lt;br /&gt;
 53 52  1  0 &lt;br /&gt;
 54 53  1  0 &lt;br /&gt;
 55 54  1  0 &lt;br /&gt;
 56 55  1  0 &lt;br /&gt;
 57 56  1  0 &lt;br /&gt;
 58 57  1  0 &lt;br /&gt;
 59 58  1  0 &lt;br /&gt;
 60 59  1  0 &lt;br /&gt;
 61 60  1  0 &lt;br /&gt;
 62 61  1  0 &lt;br /&gt;
 63 62  1  0 &lt;br /&gt;
 64 63  1  0 &lt;br /&gt;
 66 65  1  0 &lt;br /&gt;
 67 66  1  0 &lt;br /&gt;
 68 67  1  0 &lt;br /&gt;
 69 68  1  0 &lt;br /&gt;
 70 69  1  0 &lt;br /&gt;
 72 71  1  0 &lt;br /&gt;
 73 72  1  0 &lt;br /&gt;
 74 73  1  0 &lt;br /&gt;
 75 74  1  0 &lt;br /&gt;
 48 65  1  0 &lt;br /&gt;
 52 76  1  0 &lt;br /&gt;
 56 77  1  0 &lt;br /&gt;
 60 78  1  0 &lt;br /&gt;
 64 79  1  0 &lt;br /&gt;
 67 80  1  0 &lt;br /&gt;
 71 81  1  0 &lt;br /&gt;
 75 82  1  0 &lt;br /&gt;
 64 83  1  0 &lt;br /&gt;
 75 84  1  0 &lt;br /&gt;
 44 85  1  0 &lt;br /&gt;
 40 84  1  0 &lt;br /&gt;
 41 83  1  0 &lt;br /&gt;
 86 87  1  0 &lt;br /&gt;
 27 87  1  0 &lt;br /&gt;
 28 88  1  0 &lt;br /&gt;
 89 90  1  0 &lt;br /&gt;
 90 91  1  0 &lt;br /&gt;
 91 92  1  0 &lt;br /&gt;
 92 93  1  0 &lt;br /&gt;
 89 93  1  0 &lt;br /&gt;
 71 89  1  0 &lt;br /&gt;
 70 92  1  0 &lt;br /&gt;
 87 94  1  0 &lt;br /&gt;
 88 95  1  0 &lt;br /&gt;
 95 94  1  0 &lt;br /&gt;
 85 96  1  0 &lt;br /&gt;
 96 97  2  0 &lt;br /&gt;
 96 98  1  0 &lt;br /&gt;
 96 99  1  0 &lt;br /&gt;
 99100  1  0 &lt;br /&gt;
A   43 &lt;br /&gt;
Glc &lt;br /&gt;
A  100 &lt;br /&gt;
Ino &lt;br /&gt;
S  SKP  6 &lt;br /&gt;
AUTODRAW	FALSE &lt;br /&gt;
ID	EEL1048 &lt;br /&gt;
FORMULA	C88H175O9P &lt;br /&gt;
EXACTMASS	1407.2973737080001 &lt;br /&gt;
AVERAGEMASS	1408.299461 &lt;br /&gt;
SMILES	C(C([H])2COP(O)(=O)OC)OCCC(C)CCCC(CCCC(CCCC(CCC(C)CCCC(CCCC(C)CCCC(C)CCOC([H])(COC)COCCC(C)CCCC(CCCC(C)CCCC(CCC(CCCC(C)C(C1)CC(CCCC(C)CCO2)C1)C)C)C)C)C)C)C &lt;br /&gt;
M  END &lt;br /&gt;
v&lt;/div&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
</feed>