<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AEEL3001</id>
	<title>Mol:EEL3001 - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AEEL3001"/>
	<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;action=history"/>
	<updated>2026-08-18T02:45:16Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=77475&amp;oldid=prev</id>
		<title>Yoshimoto: Yoshimoto moved page Mol:LBGAAB0N01 to Mol:EEL3001</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=77475&amp;oldid=prev"/>
		<updated>2013-07-11T02:12:51Z</updated>

		<summary type="html">&lt;p&gt;Yoshimoto moved page &lt;a href=&quot;/wiki/Mol:LBGAAB0N01&quot; class=&quot;mw-redirect&quot; title=&quot;Mol:LBGAAB0N01&quot;&gt;Mol:LBGAAB0N01&lt;/a&gt; to &lt;a href=&quot;/wiki/Mol:EEL3001&quot; title=&quot;Mol:EEL3001&quot;&gt;Mol:EEL3001&lt;/a&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:12, 11 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;4&quot; class=&quot;diff-notice&quot; lang=&quot;en&quot;&gt;&lt;div class=&quot;mw-diff-empty&quot;&gt;(No difference)&lt;/div&gt;
&lt;/td&gt;&lt;/tr&gt;
&lt;!-- diff cache key wikidb:diff:1.41:old-77473:rev-77475 --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=77473&amp;oldid=prev</id>
		<title>Yoshimoto: Yoshimoto moved page Mol:EEL3001 to Mol:LBGAAB0N01 over redirect</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=77473&amp;oldid=prev"/>
		<updated>2013-07-11T02:12:07Z</updated>

		<summary type="html">&lt;p&gt;Yoshimoto moved page &lt;a href=&quot;/wiki/Mol:EEL3001&quot; title=&quot;Mol:EEL3001&quot;&gt;Mol:EEL3001&lt;/a&gt; to &lt;a href=&quot;/wiki/Mol:LBGAAB0N01&quot; class=&quot;mw-redirect&quot; title=&quot;Mol:LBGAAB0N01&quot;&gt;Mol:LBGAAB0N01&lt;/a&gt; over redirect&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:12, 11 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;4&quot; class=&quot;diff-notice&quot; lang=&quot;en&quot;&gt;&lt;div class=&quot;mw-diff-empty&quot;&gt;(No difference)&lt;/div&gt;
&lt;/td&gt;&lt;/tr&gt;
&lt;!-- diff cache key wikidb:diff:1.41:old-77471:rev-77473 --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=77471&amp;oldid=prev</id>
		<title>Yoshimoto: Yoshimoto moved page Mol:LBGAAB0N01 to Mol:EEL3001</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=77471&amp;oldid=prev"/>
		<updated>2013-07-11T02:10:10Z</updated>

		<summary type="html">&lt;p&gt;Yoshimoto moved page &lt;a href=&quot;/wiki/Mol:LBGAAB0N01&quot; class=&quot;mw-redirect&quot; title=&quot;Mol:LBGAAB0N01&quot;&gt;Mol:LBGAAB0N01&lt;/a&gt; to &lt;a href=&quot;/wiki/Mol:EEL3001&quot; title=&quot;Mol:EEL3001&quot;&gt;Mol:EEL3001&lt;/a&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:10, 11 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;4&quot; class=&quot;diff-notice&quot; lang=&quot;en&quot;&gt;&lt;div class=&quot;mw-diff-empty&quot;&gt;(No difference)&lt;/div&gt;
&lt;/td&gt;&lt;/tr&gt;
&lt;!-- diff cache key wikidb:diff:1.41:old-77463:rev-77471 --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=77463&amp;oldid=prev</id>
		<title>Yoshimoto: Yoshimoto moved page Mol:EEL3001 to Mol:LBGAAB0N01</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=77463&amp;oldid=prev"/>
		<updated>2013-07-11T02:07:13Z</updated>

		<summary type="html">&lt;p&gt;Yoshimoto moved page &lt;a href=&quot;/wiki/Mol:EEL3001&quot; title=&quot;Mol:EEL3001&quot;&gt;Mol:EEL3001&lt;/a&gt; to &lt;a href=&quot;/wiki/Mol:LBGAAB0N01&quot; class=&quot;mw-redirect&quot; title=&quot;Mol:LBGAAB0N01&quot;&gt;Mol:LBGAAB0N01&lt;/a&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;1&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;1&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:07, 11 July 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-notice&quot; lang=&quot;en&quot;&gt;&lt;div class=&quot;mw-diff-empty&quot;&gt;(No difference)&lt;/div&gt;
&lt;/td&gt;&lt;/tr&gt;&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=71210&amp;oldid=prev</id>
		<title>Editor at 04:12, 11 May 2012</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:EEL3001&amp;diff=71210&amp;oldid=prev"/>
		<updated>2012-05-11T04:12:14Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
 47 46  0  0  0  0  0  0  0  0999 V2000 &lt;br /&gt;
   -6.0814   -1.7678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.5012   -0.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.1229    0.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.4477    1.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.6922    1.7678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.9684   -0.0829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.4622    0.8724    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.8250    1.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.1104    1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3963    1.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.6821    1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.9676    1.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.2533    1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.5388    1.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.1754    1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.8900    1.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.6043    1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.3187    1.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.0330    1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.7474    1.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.4616    1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.1761    1.3443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2142   -0.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.4999   -0.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.7856   -0.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.0714   -0.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.3571   -0.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6426   -0.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0716   -0.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7862   -0.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.5005   -0.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.2151   -0.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.9293   -0.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.6436   -0.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3578   -0.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0724   -0.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7867   -0.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3963    0.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.5388    0.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.3187    0.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.1761    0.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.7856   -1.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0716   -1.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.9293   -1.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7867   -1.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.8905    1.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.5012   -0.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0 &lt;br /&gt;
  2  3  1  0 &lt;br /&gt;
  3  4  1  0 &lt;br /&gt;
  4  5  1  0 &lt;br /&gt;
  3  7  1  0 &lt;br /&gt;
  3  6  1  0 &lt;br /&gt;
  8  5  1  0 &lt;br /&gt;
  9  8  1  0 &lt;br /&gt;
 10  9  1  0 &lt;br /&gt;
 11 10  1  0 &lt;br /&gt;
 12 11  1  0 &lt;br /&gt;
 13 12  1  0 &lt;br /&gt;
 14 13  1  0 &lt;br /&gt;
 15 14  1  0 &lt;br /&gt;
 16 15  1  0 &lt;br /&gt;
 17 16  1  0 &lt;br /&gt;
 18 17  1  0 &lt;br /&gt;
 19 18  1  0 &lt;br /&gt;
 20 19  1  0 &lt;br /&gt;
 21 20  1  0 &lt;br /&gt;
 22 21  1  0 &lt;br /&gt;
 24 23  1  0 &lt;br /&gt;
 25 24  1  0 &lt;br /&gt;
 26 25  1  0 &lt;br /&gt;
 27 26  1  0 &lt;br /&gt;
 28 27  1  0 &lt;br /&gt;
 29 28  1  0 &lt;br /&gt;
 30 29  1  0 &lt;br /&gt;
 31 30  1  0 &lt;br /&gt;
 32 31  1  0 &lt;br /&gt;
 33 32  1  0 &lt;br /&gt;
 34 33  1  0 &lt;br /&gt;
 35 34  1  0 &lt;br /&gt;
 36 35  1  0 &lt;br /&gt;
 37 36  1  0 &lt;br /&gt;
  6 23  1  0 &lt;br /&gt;
 10 38  1  0 &lt;br /&gt;
 14 39  1  0 &lt;br /&gt;
 18 40  1  0 &lt;br /&gt;
 22 41  1  0 &lt;br /&gt;
 25 42  1  0 &lt;br /&gt;
 29 43  1  0 &lt;br /&gt;
 33 44  1  0 &lt;br /&gt;
 37 45  1  0 &lt;br /&gt;
 22 46  1  0 &lt;br /&gt;
 37 47  1  0 &lt;br /&gt;
S  SKP  6 &lt;br /&gt;
ID	EEL3001 &lt;br /&gt;
FORMULA	C43H88O3 &lt;br /&gt;
EXACTMASS	652.673346682 &lt;br /&gt;
AVERAGEMASS	653.15702 &lt;br /&gt;
SMILES	C(CC(C)CCCC(C)CCCC(C)C)CC(CCOCC([H])(OCCC(C)CCCC(C)CCCC(C)CCCC(C)C)CO)C &lt;br /&gt;
AUTODRAW	FALSE &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
</feed>