<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ALBGAHI1N02</id>
	<title>Mol:LBGAHI1N02 - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ALBGAHI1N02"/>
	<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:LBGAHI1N02&amp;action=history"/>
	<updated>2026-07-11T04:40:12Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:LBGAHI1N02&amp;diff=76510&amp;oldid=prev</id>
		<title>Yoshimoto at 06:36, 14 June 2013</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:LBGAHI1N02&amp;diff=76510&amp;oldid=prev"/>
		<updated>2013-06-14T06:36:07Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 15:36, 14 June 2013&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l1&quot;&gt;Line 1:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 1:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;EEL0005.mol &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-added&quot;&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;  ChemDraw05241312312D &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-added&quot;&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt; &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;Copyright: ARM project http://www.metabolome.jp/ &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  53 52  0  0  0  0  0  0  0  0999 V2000  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  53 52  0  0  0  0  0  0  0  0999 V2000  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;    -5.8822   -1.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;    -5.8822   -1.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l110&quot;&gt;Line 110:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 110:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   52  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   52  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Ino  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	LBGAHI1N02  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	LBGAHI1N02  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C44H91O7P  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C44H91O7P  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:LBGAHI1N02&amp;diff=76507&amp;oldid=prev</id>
		<title>Yoshimoto: Created page with &quot;EEL0005.mol    ChemDraw05241312312D     53 52  0  0  0  0  0  0  0  0999 V2000     -5.8822   -1.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0     -6.5014   -0.1132    ...&quot;</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:LBGAHI1N02&amp;diff=76507&amp;oldid=prev"/>
		<updated>2013-06-14T06:35:48Z</updated>

		<summary type="html">&lt;p&gt;Created page with &amp;quot;EEL0005.mol    ChemDraw05241312312D     53 52  0  0  0  0  0  0  0  0999 V2000     -5.8822   -1.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0     -6.5014   -0.1132    ...&amp;quot;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;EEL0005.mol &lt;br /&gt;
  ChemDraw05241312312D &lt;br /&gt;
 &lt;br /&gt;
 53 52  0  0  0  0  0  0  0  0999 V2000 &lt;br /&gt;
   -5.8822   -1.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.5014   -0.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.1231    0.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -6.4479    1.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.6924    2.2956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.9687    0.4449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -5.4624    1.4003    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.8251    1.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.1105    2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3964    1.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.6822    2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.9677    1.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.2533    2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.5388    1.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.1754    2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.8900    1.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.6043    2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.3188    1.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.0331    2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.7475    1.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.4617    2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.1763    1.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.2143   -0.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.5000    0.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.7857   -0.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.0715    0.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -1.3571   -0.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.6426    0.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0716   -0.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.7862    0.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    1.5005   -0.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.2152    0.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.9294   -0.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.6437    0.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.3579   -0.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0726    0.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7869   -0.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3964    1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -0.5388    1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.3188    1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.1763    1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -2.7857   -0.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    0.0716   -0.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    2.9294   -0.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.7869   -0.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.8907    2.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.5014    0.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.9999   -1.8721    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.9999   -2.6971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.1749   -1.8721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -4.9999   -1.0471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3499   -1.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   -3.3964    2.6971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0 &lt;br /&gt;
  2  3  1  0 &lt;br /&gt;
  3  4  1  0 &lt;br /&gt;
  4  5  1  0 &lt;br /&gt;
  3  7  1  0 &lt;br /&gt;
  3  6  1  0 &lt;br /&gt;
  8  5  1  0 &lt;br /&gt;
  9  8  1  0 &lt;br /&gt;
 10  9  1  0 &lt;br /&gt;
 11 10  1  0 &lt;br /&gt;
 12 11  1  0 &lt;br /&gt;
 13 12  1  0 &lt;br /&gt;
 14 13  1  0 &lt;br /&gt;
 15 14  1  0 &lt;br /&gt;
 16 15  1  0 &lt;br /&gt;
 17 16  1  0 &lt;br /&gt;
 18 17  1  0 &lt;br /&gt;
 19 18  1  0 &lt;br /&gt;
 20 19  1  0 &lt;br /&gt;
 21 20  1  0 &lt;br /&gt;
 22 21  1  0 &lt;br /&gt;
 24 23  1  0 &lt;br /&gt;
 25 24  1  0 &lt;br /&gt;
 26 25  1  0 &lt;br /&gt;
 27 26  1  0 &lt;br /&gt;
 28 27  1  0 &lt;br /&gt;
 29 28  1  0 &lt;br /&gt;
 30 29  1  0 &lt;br /&gt;
 31 30  1  0 &lt;br /&gt;
 32 31  1  0 &lt;br /&gt;
 33 32  1  0 &lt;br /&gt;
 34 33  1  0 &lt;br /&gt;
 35 34  1  0 &lt;br /&gt;
 36 35  1  0 &lt;br /&gt;
 37 36  1  0 &lt;br /&gt;
  6 23  1  0 &lt;br /&gt;
 10 38  1  0 &lt;br /&gt;
 14 39  1  0 &lt;br /&gt;
 18 40  1  0 &lt;br /&gt;
 22 41  1  0 &lt;br /&gt;
 25 42  1  0 &lt;br /&gt;
 29 43  1  0 &lt;br /&gt;
 33 44  1  0 &lt;br /&gt;
 37 45  1  0 &lt;br /&gt;
 22 46  1  0 &lt;br /&gt;
 37 47  1  0 &lt;br /&gt;
  1 48  1  0 &lt;br /&gt;
 48 49  1  0 &lt;br /&gt;
 48 50  1  0 &lt;br /&gt;
 48 51  2  0 &lt;br /&gt;
 50 52  1  0 &lt;br /&gt;
 10 53  1  0 &lt;br /&gt;
A   52 &lt;br /&gt;
Ino &lt;br /&gt;
S  SKP  5 &lt;br /&gt;
ID	LBGAHI1N02 &lt;br /&gt;
FORMULA	C44H91O7P &lt;br /&gt;
EXACTMASS	762.650241776 &lt;br /&gt;
AVERAGEMASS	763.162901 &lt;br /&gt;
SMILES	O(C(COP(OC)(O)=O)([H])COCCC(CCCC(CCCC(C)CCCC(C)C)C)(C)O)CCC(CCCC(CCCC(CCCC(C)C)C)C)C &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
</feed>