<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AVCA1108</id>
	<title>Mol:VCA1108 - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AVCA1108"/>
	<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;action=history"/>
	<updated>2026-07-10T13:07:24Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;diff=82727&amp;oldid=prev</id>
		<title>Yoshimoto at 01:05, 19 November 2014</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;diff=82727&amp;oldid=prev"/>
		<updated>2014-11-19T01:05:48Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 10:05, 19 November 2014&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l91&quot;&gt;Line 91:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 91:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  39 43  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  39 43  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   3 44  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   3 44  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	VCA1108  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	VCA1108  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C40H56O4  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C40H56O4  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l97&quot;&gt;Line 97:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 97:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	600.8702400000001  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	600.8702400000001  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	C(O)(C1O)C(=C(C(C1)(C)C)C=CC(C)=CC=CC(C)=CC=CC=C(C=CC=C(C=CC=C(C=CC(O)C(C)(C)O)C)C)C)C  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	C(O)(C1O)C(=C(C(C1)(C)C)C=CC(C)=CC=CC(C)=CC=CC=C(C=CC=C(C=CC=C(C=CC(O)C(C)(C)O)C)C)C)C  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-82724:rev-82727:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;diff=82724&amp;oldid=prev</id>
		<title>Yoshimoto at 01:05, 19 November 2014</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;diff=82724&amp;oldid=prev"/>
		<updated>2014-11-19T01:05:01Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;a href=&quot;//lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;amp;diff=82724&amp;amp;oldid=82719&quot;&gt;Show changes&lt;/a&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;diff=82719&amp;oldid=prev</id>
		<title>Yoshimoto at 00:49, 19 November 2014</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;diff=82719&amp;oldid=prev"/>
		<updated>2014-11-19T00:49:25Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 09:49, 19 November 2014&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l91&quot;&gt;Line 91:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 91:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  39 43  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  39 43  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   3 44  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;   3 44  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	VCA1108  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	VCA1108  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C40H56O4  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C40H56O4  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l97&quot;&gt;Line 97:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 97:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	600.8702400000001  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	600.8702400000001  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	C(O)(C1O)C(=C(C(C1)(C)C)C=CC(C)=CC=CC(C)=CC=CC=C(C=CC=C(C=CC=C(C=CC(O)C(C)(C)O)C)C)C)C  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	C(O)(C1O)C(=C(C(C1)(C)C)C=CC(C)=CC=CC(C)=CC=CC=C(C=CC=C(C=CC=C(C=CC(O)C(C)(C)O)C)C)C)C  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-82716:rev-82719:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;diff=82716&amp;oldid=prev</id>
		<title>Yoshimoto: Created page with &quot;    Copyright: ARM project http://www.metabolome.jp/   44 44  0  0  0  0  0  0  0  0  1 V2000      4.5284   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0      4.528...&quot;</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1108&amp;diff=82716&amp;oldid=prev"/>
		<updated>2014-11-19T00:46:12Z</updated>

		<summary type="html">&lt;p&gt;Created page with &amp;quot;    Copyright: ARM project http://www.metabolome.jp/   44 44  0  0  0  0  0  0  0  0  1 V2000      4.5284   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0      4.528...&amp;quot;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
 44 44  0  0  0  0  0  0  0  0  1 V2000 &lt;br /&gt;
    4.5284   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.5284   -8.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.6749   -9.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.8886   -8.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.8886   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.6749   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.0351   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.2488   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.3952   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.5415   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.7554   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   13.9017   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   15.0480   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   16.2618   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   17.4083   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.5545   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.7684   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   20.9147   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.0611   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.2749   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.4212   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   25.5675   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.0005   -5.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.3492   -5.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.0351   -9.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   26.7813   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   27.9277   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   25.5675   -8.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   20.9147   -8.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   10.3952   -5.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   15.0480   -5.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    3.3822   -9.1115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   29.0740   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   30.2879   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   31.4341   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   30.2879   -8.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   32.5805   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   33.7269   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   34.8734   -7.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   33.7911   -4.7959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   36.0197   -6.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   34.8734   -8.4372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   36.0871   -7.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.6576  -10.5071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0  0  0  0 &lt;br /&gt;
  2  3  1  0  0  0  0 &lt;br /&gt;
  3  4  1  0  0  0  0 &lt;br /&gt;
  4  5  2  0  0  0  0 &lt;br /&gt;
  5  6  1  0  0  0  0 &lt;br /&gt;
  1  6  1  0  0  0  0 &lt;br /&gt;
  5  7  1  0  0  0  0 &lt;br /&gt;
  7  8  2  0  0  0  0 &lt;br /&gt;
  8  9  1  0  0  0  0 &lt;br /&gt;
  9 10  2  0  0  0  0 &lt;br /&gt;
 10 11  1  0  0  0  0 &lt;br /&gt;
 11 12  2  0  0  0  0 &lt;br /&gt;
 12 13  1  0  0  0  0 &lt;br /&gt;
 13 14  2  0  0  0  0 &lt;br /&gt;
 14 15  1  0  0  0  0 &lt;br /&gt;
 15 16  2  0  0  0  0 &lt;br /&gt;
 16 17  1  0  0  0  0 &lt;br /&gt;
 17 18  2  0  0  0  0 &lt;br /&gt;
 18 19  1  0  0  0  0 &lt;br /&gt;
 19 20  2  0  0  0  0 &lt;br /&gt;
 20 21  1  0  0  0  0 &lt;br /&gt;
 21 22  2  0  0  0  0 &lt;br /&gt;
  6 23  1  0  0  0  0 &lt;br /&gt;
  6 24  1  0  0  0  0 &lt;br /&gt;
  4 25  1  0  0  0  0 &lt;br /&gt;
 22 26  1  0  0  0  0 &lt;br /&gt;
 26 27  2  0  0  0  0 &lt;br /&gt;
 22 28  1  0  0  0  0 &lt;br /&gt;
 18 29  1  0  0  0  0 &lt;br /&gt;
  9 30  1  0  0  0  0 &lt;br /&gt;
 13 31  1  0  0  0  0 &lt;br /&gt;
  2 32  1  0  0  0  0 &lt;br /&gt;
 27 33  1  0  0  0  0 &lt;br /&gt;
 33 34  2  0  0  0  0 &lt;br /&gt;
 34 35  1  0  0  0  0 &lt;br /&gt;
 34 36  1  0  0  0  0 &lt;br /&gt;
 35 37  2  0  0  0  0 &lt;br /&gt;
 37 38  1  0  0  0  0 &lt;br /&gt;
 38 39  1  0  0  0  0 &lt;br /&gt;
 38 40  1  0  0  0  0 &lt;br /&gt;
 39 41  1  0  0  0  0 &lt;br /&gt;
 39 42  1  0  0  0  0 &lt;br /&gt;
 39 43  1  0  0  0  0 &lt;br /&gt;
  3 44  1  0  0  0  0 &lt;br /&gt;
S  SKP  5 &lt;br /&gt;
ID	VCA1108 &lt;br /&gt;
FORMULA	C40H56O4 &lt;br /&gt;
EXACTMASS	600.41786028 &lt;br /&gt;
AVERAGEMASS	600.8702400000001 &lt;br /&gt;
SMILES	C(O)(C1O)C(=C(C(C1)(C)C)C=CC(C)=CC=CC(C)=CC=CC=C(C=CC=C(C=CC=C(C=CC(O)C(C)(C)O)C)C)C)C &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
</feed>