<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AVCA1183</id>
	<title>Mol:VCA1183 - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://lipidbank.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3AVCA1183"/>
	<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1183&amp;action=history"/>
	<updated>2026-09-08T23:06:58Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1183&amp;diff=83525&amp;oldid=prev</id>
		<title>Editor at 04:17, 20 November 2014</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1183&amp;diff=83525&amp;oldid=prev"/>
		<updated>2014-11-20T04:17:38Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 13:17, 20 November 2014&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l89&quot;&gt;Line 89:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 89:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  30 42  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  30 42  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  40 43  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;  40 43  1  0  0  0  0  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   43  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   43 Glc  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Glc  &lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-added&quot;&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  6  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  6  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	VCA1183  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	VCA1183  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-82759:rev-83525:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1183&amp;diff=82759&amp;oldid=prev</id>
		<title>Yoshimoto at 02:17, 19 November 2014</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1183&amp;diff=82759&amp;oldid=prev"/>
		<updated>2014-11-19T02:17:11Z</updated>

		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table style=&quot;background-color: #fff; color: #202122;&quot; data-mw=&quot;interface&quot;&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;col class=&quot;diff-marker&quot; /&gt;
				&lt;col class=&quot;diff-content&quot; /&gt;
				&lt;tr class=&quot;diff-title&quot; lang=&quot;en&quot;&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;← Older revision&lt;/td&gt;
				&lt;td colspan=&quot;2&quot; style=&quot;background-color: #fff; color: #202122; text-align: center;&quot;&gt;Revision as of 11:17, 19 November 2014&lt;/td&gt;
				&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l91&quot;&gt;Line 91:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 91:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   43  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;A   43  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Glc  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;Glc  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;−&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #ffe49c; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;del style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;5 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;S  SKP  &lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;6 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	VCA1183  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;ID	VCA1183  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C41H56O2  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;FORMULA	C41H56O2  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot; id=&quot;mw-diff-left-l97&quot;&gt;Line 97:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 97:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	580.8821399999999  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;AVERAGEMASS	580.8821399999999  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	C(C(C)=1)(=O)CCC(C(C=CC(C)=CC=CC(C)=CC=CC=C(C=CC=C(C=CC=C(C)C=CCC(C)(C)OC)C)C)1)(C)C  &lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;SMILES	C(C(C)=1)(=O)CCC(C(C=CC(C)=CC=CC(C)=CC=CC=C(C=CC=C(C=CC=C(C)C=CCC(C)(C)OC)C)C)1)(C)C  &lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-side-deleted&quot;&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot; data-marker=&quot;+&quot;&gt;&lt;/td&gt;&lt;td style=&quot;color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #a3d3ff; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;font-weight: bold; text-decoration: none;&quot;&gt;AUTODRAW	FALSE &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;td class=&quot;diff-marker&quot;&gt;&lt;/td&gt;&lt;td style=&quot;background-color: #f8f9fa; color: #202122; font-size: 88%; border-style: solid; border-width: 1px 1px 1px 4px; border-radius: 0.33em; border-color: #eaecf0; vertical-align: top; white-space: pre-wrap;&quot;&gt;&lt;div&gt;M  END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;

&lt;!-- diff cache key wikidb:diff:1.41:old-82756:rev-82759:php=table --&gt;
&lt;/table&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
	<entry>
		<id>https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1183&amp;diff=82756&amp;oldid=prev</id>
		<title>Yoshimoto: Created page with &quot;    Copyright: ARM project http://www.metabolome.jp/   43 43  0  0  0  0  0  0  0  0  3 V2000      4.2058   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0      4.205...&quot;</title>
		<link rel="alternate" type="text/html" href="https://lipidbank.jp/mediawiki/index.php?title=Mol:VCA1183&amp;diff=82756&amp;oldid=prev"/>
		<updated>2014-11-19T02:16:17Z</updated>

		<summary type="html">&lt;p&gt;Created page with &amp;quot;    Copyright: ARM project http://www.metabolome.jp/   43 43  0  0  0  0  0  0  0  0  3 V2000      4.2058   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0      4.205...&amp;quot;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
 43 43  0  0  0  0  0  0  0  0  3 V2000 &lt;br /&gt;
    4.2058   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.2058   -6.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.3577   -7.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.5096   -6.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.5096   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.3577   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.6852   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    8.8371   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.9888   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   11.1407   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   12.2926   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   13.4443   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   14.5961   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   15.7481   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   16.8998   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.0517   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.2034   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   20.3553   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   21.5072   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.6589   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.8107   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.9627   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   26.1144   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   27.2662   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   28.4180   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   29.5699   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   30.7217   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   31.8735   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   33.0253   -4.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   34.1773   -5.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    6.2982   -3.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    4.4173   -3.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    9.9888   -3.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   14.5961   -3.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   20.3553   -6.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.9627   -6.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   29.5699   -6.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    7.6791   -7.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   35.3442   -4.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   34.1773   -6.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
    5.3578   -8.7620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   35.3303   -6.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   33.1058   -7.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0  0  0  0 &lt;br /&gt;
  2  3  1  0  0  0  0 &lt;br /&gt;
  3  4  1  0  0  0  0 &lt;br /&gt;
  4  5  2  0  0  0  0 &lt;br /&gt;
  5  6  1  0  0  0  0 &lt;br /&gt;
  1  6  1  0  0  0  0 &lt;br /&gt;
  5  7  1  0  0  0  0 &lt;br /&gt;
  7  8  2  0  0  0  0 &lt;br /&gt;
  8  9  1  0  0  0  0 &lt;br /&gt;
  9 10  2  0  0  0  0 &lt;br /&gt;
 10 11  1  0  0  0  0 &lt;br /&gt;
 11 12  2  0  0  0  0 &lt;br /&gt;
 12 13  1  0  0  0  0 &lt;br /&gt;
 13 14  2  0  0  0  0 &lt;br /&gt;
 14 15  1  0  0  0  0 &lt;br /&gt;
 15 16  2  0  0  0  0 &lt;br /&gt;
 16 17  1  0  0  0  0 &lt;br /&gt;
 17 18  2  0  0  0  0 &lt;br /&gt;
 18 19  1  0  0  0  0 &lt;br /&gt;
 19 20  2  0  0  0  0 &lt;br /&gt;
 20 21  1  0  0  0  0 &lt;br /&gt;
 21 22  2  0  0  0  0 &lt;br /&gt;
 22 23  1  0  0  0  0 &lt;br /&gt;
 23 24  2  0  0  0  0 &lt;br /&gt;
 24 25  1  0  0  0  0 &lt;br /&gt;
 25 26  2  0  0  0  0 &lt;br /&gt;
 26 27  1  0  0  0  0 &lt;br /&gt;
 27 28  2  0  0  0  0 &lt;br /&gt;
 28 29  1  0  0  0  0 &lt;br /&gt;
 29 30  1  0  0  0  0 &lt;br /&gt;
  6 31  1  0  0  0  0 &lt;br /&gt;
  6 32  1  0  0  0  0 &lt;br /&gt;
  9 33  1  0  0  0  0 &lt;br /&gt;
 13 34  1  0  0  0  0 &lt;br /&gt;
 18 35  1  0  0  0  0 &lt;br /&gt;
 22 36  1  0  0  0  0 &lt;br /&gt;
 26 37  1  0  0  0  0 &lt;br /&gt;
  4 38  1  0  0  0  0 &lt;br /&gt;
 30 39  1  0  0  0  0 &lt;br /&gt;
 30 40  1  0  0  0  0 &lt;br /&gt;
  3 41  2  0  0  0  0 &lt;br /&gt;
 30 42  1  0  0  0  0 &lt;br /&gt;
 40 43  1  0  0  0  0 &lt;br /&gt;
A   43 &lt;br /&gt;
Glc &lt;br /&gt;
S  SKP  5 &lt;br /&gt;
ID	VCA1183 &lt;br /&gt;
FORMULA	C41H56O2 &lt;br /&gt;
EXACTMASS	580.428031036 &lt;br /&gt;
AVERAGEMASS	580.8821399999999 &lt;br /&gt;
SMILES	C(C(C)=1)(=O)CCC(C(C=CC(C)=CC=CC(C)=CC=CC=C(C=CC=C(C=CC=C(C)C=CCC(C)(C)OC)C)C)1)(C)C &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Yoshimoto</name></author>
	</entry>
</feed>