LBF22409SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030177 | |LipidMaps=LMFA01030177 | ||
|SysName=4, 7, 10, 13-Docosatetraenoic acid | |SysName=4, 7, 10, 13-Docosatetraenoic acid | ||
|Solubility=soluble in acetone, methyl alcohol and petroleum ether. | |Solubility=soluble in acetone, methyl alcohol and petroleum ether.[[Reference:Klenk_E:Bongard_W:,Hoppe Seylers Z. Physiol. Chem.,1952,291,104|{{RelationTable/GetFirstAuthor|Reference:Klenk_E:Bongard_W:,Hoppe Seylers Z. Physiol. Chem.,1952,291,104}}]][[Reference:Klenk_E:Lindlar_F:,Hoppe Seylers Z. Physiol. Chem.,1955,299,74|{{RelationTable/GetFirstAuthor|Reference:Klenk_E:Lindlar_F:,Hoppe Seylers Z. Physiol. Chem.,1955,299,74}}]] | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0216 |
| LipidMaps | LMFA01030177 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF22409SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 4, 7, 10, 13-Docosatetraenoic acid | |
| Formula | C22H36O2 |
| Exact Mass | 332.271530396 |
| Average Mass | 332.52004000000005 |
| SMILES | C(CCC(O)=O)=CCC=CCC=CCC=CCCCCCCCC |
| Physicochemical Information | |
| soluble in acetone, methyl alcohol and petroleum ether. KlenkEet al. KlenkEet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
