LBF18306SC03
| IDs and Links | |
|---|---|
| LipidBank | DFA0182 |
| LipidMaps | LMFA01030143 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18306SC03 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| cis-8, trans-10, cis-12-Octadecatrienoic acid | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCCC=CC=CC=CCCCCCCC(O)=O |
| Physicochemical Information | |
| 43.5-44°C | |
| very soluble in petroleumether and soluble in acetone, ethanol, CS2 and pentane.<<0125>> | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
