LBF19206HP01
IDs and Links | |
---|---|
LipidBank | DFA8090 |
LipidMaps | LMFA01040028 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF19206HP01 |
7- [3,5-Epidioxy-2- (2-octenyl) cyclopentyl] -5-hydroperoxy-6-heptenoic acid | |
---|---|
Structural Information | |
7- [3,5-Epidioxy-2- (2-octenyl) cyclopentyl] -5-hydroperoxy-6-heptenoic acid | |
| |
Formula | C19H30O6 |
Exact Mass | 354.204238692 |
Average Mass | 354.4379 |
SMILES | CCCCCC=CCC(C21)C(=CC(OO)CCCC(O)=O)C(OO2)C1 |
Physicochemical Information | |
Oxidation of arachidonic acid in the presence of hemoglobin, mioglobin Terao_J et al. or Fe(III)- ascorbic acid Yamagata_S et al.. | |
Spectral Information | |
Mass Spectra | GC-EI-MS(Me-ester; after reduction and TMS) TeraoJet al.: m/e=569[M-CH3]; 494[M-HOTMS]; 483[M-(CH2)3COOCH3]; 404[M-2xHOTMS]; 378[494-SMTO=CHCH2]; 367[M-SMTOCH=CHCH=OTMS]; 203[SMTO=CH(CH2)3COOCH3]; 191[SMTO=CHOTMS] |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Other Spectra | |
Chromatograms |
Reported Metabolites, References | |||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|