LBF20502SC01
| IDs and Links | |
|---|---|
| LipidBank | DFA0219 |
| LipidMaps | LMFA01030180 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20502SC01 |
| Timnodonic acid | |
|---|---|
| |
| Structural Information | |
| 4, 8, 12, 15, 18-Eicosapentaenoic acid / 4, 8, 12, 15, 18-icosapentaenoic acid | |
| |
| Formula | C20H30O2 |
| Exact Mass | 302.224580204 |
| Average Mass | 302.451 |
| SMILES | C(C=CCC=CCCC=CCCC=CCCC(O)=O)C=CC |
| Physicochemical Information | |
| 0.9399 at 15 °C | |
| 1.5109 at 15 °C | |
| soluble in benzene, chloroform, ether and petroleum ether.<<0489>> | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
