LBF16401SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030165 | |LipidMaps=LMFA01030165 | ||
|SysName=4, 8, 12, 16-Hexadesatetraenoic acid | |SysName=4, 8, 12, 16-Hexadesatetraenoic acid | ||
|Solubility=soluble in acetone, alcohol, ether and petroleum ether. | |Solubility=soluble in acetone, alcohol, ether and petroleum ether.[[Reference:Klenk_E:Steinbach_H:,Hoppe Seylers Z. Physiol. Chem.,1959,316,31|{{RelationTable/GetFirstAuthor|Reference:Klenk_E:Steinbach_H:,Hoppe Seylers Z. Physiol. Chem.,1959,316,31}}]] | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0204 |
| LipidMaps | LMFA01030165 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16401SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 4, 8, 12, 16-Hexadesatetraenoic acid | |
| Formula | C16H24O2 |
| Exact Mass | 248.17763001199998 |
| Average Mass | 248.36056 |
| SMILES | C=CCC=CCCC=CCCC=CCCC(O)=O |
| Physicochemical Information | |
| soluble in acetone, alcohol, ether and petroleum ether. KlenkEet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
