LBF18000HO25: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&10,11-Dihydroxystearic acid&& | |Common Name=&&10,11-Dihydroxystearic acid&& | ||
|Melting Point=77-78°C | |Melting Point=77-78°C | ||
|Solubility=soluble in ehtanol and alcohol | |Solubility=soluble in ehtanol and alcohol[[Reference:Scanlan_JT:Swern_D:,J. Am. Chem. Soc.,1940,62,2305|{{RelationTable/GetFirstAuthor|Reference:Scanlan_JT:Swern_D:,J. Am. Chem. Soc.,1940,62,2305}}]] | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0358 |
| LipidMaps | LMFA01050092 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18000HO25 |
| 10,11-Dihydroxystearic acid | |
|---|---|
| |
| Structural Information | |
| 10,11-Dihydroxyoctadecanoic acid | |
| |
| Formula | C18H36O4 |
| Exact Mass | 316.26135963999997 |
| Average Mass | 316.47604 |
| SMILES | CCCCCCCC(O)C(O)CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 77-78°C | |
| soluble in ehtanol and alcohol Scanlan_JT et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
