Mol:LBF18303HP01

From Jcbl.jp
Jump to: navigation, search

LBF18303HP01.png

 
 
Copyright: ARM project http://www.metabolome.jp/ 
 22 21  0  0  0  0  0  0  0  0999 V2000 
    5.1031   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    5.8178   -0.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    6.5323   -0.8221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    5.8178    0.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    4.3885   -0.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    3.6740   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.9596   -0.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    2.2451   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    1.5331   -0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.8211   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.1091   -0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -0.6029   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -1.3149   -0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.0268   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -2.8518   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -3.5663   -0.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -4.2808   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -5.1058   -0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -5.8203   -0.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
   -6.5323   -0.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 
    0.1091    0.4111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
    0.8211    0.8221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 
  1  2  1  0 
  2  3  1  0 
  2  4  2  0 
  1  5  1  0 
  5  6  1  0 
  6  7  1  0 
  7  8  1  0 
  8  9  1  0 
  9 10  1  0 
 10 11  1  0 
 11 12  1  0 
 12 13  2  0 
 13 14  1  0 
 14 15  2  0 
 15 16  1  0 
 16 17  1  0 
 17 18  2  0 
 18 19  1  0 
 19 20  1  0 
 11 21  1  0 
 21 22  1  0 
S  SKP  6 
ID	LBF18303HP01 
FORMULA	C18H30O4 
EXACTMASS	310.21440944799997 
AVERAGEMASS	310.4284 
SMILES	CCC=CCC=CC=CC(OO)CCCCCCCC(O)=O 
AUTODRAW	FALSE 
M  END
Personal tools