LBF16000BC11: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01020175 | |LipidMaps=LMFA01020175 | ||
|SysName=11,15-Dimethyl Hexadecanoic Acid | |SysName=11,15-Dimethyl Hexadecanoic Acid | ||
|Common Name=&&11,15-Dimethyl Hexadecanoic Acid&& | |||
|Boiling Point=165-172°C/0.5Torr | |Boiling Point=165-172°C/0.5Torr | ||
|Optical=<FONT FACE="Symbol">h</FONT>20/D=1.4480 | |Optical=<FONT FACE="Symbol">h</FONT>20/D=1.4480 | ||
}} | }} | ||
Revision as of 08:08, 18 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7143 |
| LipidMaps | LMFA01020175 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16000BC11 |
| 11,15-Dimethyl Hexadecanoic Acid | |
|---|---|
| |
| Structural Information | |
| 11,15-Dimethyl Hexadecanoic Acid | |
| |
| Formula | C18H36O2 |
| Exact Mass | 284.271530396 |
| Average Mass | 284.47724 |
| SMILES | CC(C)CCCC(C)CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| 165-172°C/0.5Torr | |
| h20/D=1.4480 | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
