LBF16000OX08: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01060057 | |LipidMaps=LMFA01060057 | ||
|SysName=10-Oxohexadecanoic acid | |SysName=10-Oxohexadecanoic acid | ||
|Common Name=&&10-Ketopalmitic acid&& | |Common Name=&&10-Ketopalmitic acid&&10-Oxohexadecanoic acid&& | ||
|Melting Point=75-75.8°C | |Melting Point=75-75.8°C | ||
|Solubility=[[Reference:Fordyce_CR:Johnson_JR:,J. Am. Chem. Soc.,1933,55,3368|{{RelationTable/GetFirstAuthor|Reference:Fordyce_CR:Johnson_JR:,J. Am. Chem. Soc.,1933,55,3368}}]] | |Solubility=[[Reference:Fordyce_CR:Johnson_JR:,J. Am. Chem. Soc.,1933,55,3368|{{RelationTable/GetFirstAuthor|Reference:Fordyce_CR:Johnson_JR:,J. Am. Chem. Soc.,1933,55,3368}}]] | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0441 |
| LipidMaps | LMFA01060057 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16000OX08 |
| 10-Ketopalmitic acid | |
|---|---|
| |
| Structural Information | |
| 10-Oxohexadecanoic acid | |
| |
| Formula | C16H30O3 |
| Exact Mass | 270.21949482599996 |
| Average Mass | 270.4076 |
| SMILES | CCCCCCC(=O)CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 75-75.8°C | |
| Fordyce_CR et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
