LBF17000BC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01020013 | |LipidMaps=LMFA01020013 | ||
|SysName=10-Methylheptadecanoic acid | |SysName=10-Methylheptadecanoic acid | ||
|Common Name=&&10-Methylheptadecanoic acid&& | |||
|Melting Point=33.5°C | |Melting Point=33.5°C | ||
|Solubility=soluble in acetone and glacial acetic acid[[Reference:Weitzel_G:Wojahn_J:,Hoppe Seylers Z. Physiol. Chem.,1950,285,220|{{RelationTable/GetFirstAuthor|Reference:Weitzel_G:Wojahn_J:,Hoppe Seylers Z. Physiol. Chem.,1950,285,220}}]] | |Solubility=soluble in acetone and glacial acetic acid [[Reference:Weitzel_G:Wojahn_J:,Hoppe Seylers Z. Physiol. Chem.,1950,285,220|{{RelationTable/GetFirstAuthor|Reference:Weitzel_G:Wojahn_J:,Hoppe Seylers Z. Physiol. Chem.,1950,285,220}}]] | ||
}} | }} | ||
Revision as of 08:09, 18 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0238 |
| LipidMaps | LMFA01020013 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF17000BC01 |
| 10-Methylheptadecanoic acid | |
|---|---|
| |
| Structural Information | |
| 10-Methylheptadecanoic acid | |
| |
| Formula | C18H36O2 |
| Exact Mass | 284.271530396 |
| Average Mass | 284.47724 |
| SMILES | CCCCCCCC(C)CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 33.5°C | |
| soluble in acetone and glacial acetic acid WeitzelGet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
