LBF17000OX01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&9-Ketoheptadecylic acid&&9-Ketomargaric acid&& | |Common Name=&&9-Ketoheptadecylic acid&&9-Ketomargaric acid&& | ||
|Melting Point=78.5°C | |Melting Point=78.5°C | ||
|Solubility= | |Solubility= | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0443 |
| LipidMaps | LMFA01060059 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF17000OX01 |
| 9-Ketoheptadecylic acid | |
|---|---|
| |
| Structural Information | |
| 9-Oxoheptadecanoic acid | |
| |
| Formula | C17H32O3 |
| Exact Mass | 284.23514489 |
| Average Mass | 284.43417999999997 |
| SMILES | CCCCCCCCC(=O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| 78.5°C | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
