LBF18206HO02: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01050111 | |LipidMaps=LMFA01050111 | ||
|SysName=9-Hydroxy-trans-10,trans-12-octadecadienoic acid | |SysName=9-Hydroxy-trans-10,trans-12-octadecadienoic acid | ||
|Common Name=&&Dimorphecolic acid&&alpha-dimorphecolic acid&& | |Common Name=&&Dimorphecolic acid&&alpha-dimorphecolic acid&&9-Hydroxy-trans-10,trans-12-octadecadienoic acid&& | ||
|Solubility=/[[Reference:Smith_CR_Jr:Wilson_TL:Melvin_EH:Wolff_A:,J. Am. Chem. Soc.,1960,82,1417|{{RelationTable/GetFirstAuthor|Reference:Smith_CR_Jr:Wilson_TL:Melvin_EH:Wolff_A:,J. Am. Chem. Soc.,1960,82,1417}}]]/ | |Solubility=/[[Reference:Smith_CR_Jr:Wilson_TL:Melvin_EH:Wolff_A:,J. Am. Chem. Soc.,1960,82,1417|{{RelationTable/GetFirstAuthor|Reference:Smith_CR_Jr:Wilson_TL:Melvin_EH:Wolff_A:,J. Am. Chem. Soc.,1960,82,1417}}]]/ | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0377 |
| LipidMaps | LMFA01050111 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18206HO02 |
| Dimorphecolic acid | |
|---|---|
| |
| Structural Information | |
| 9-Hydroxy-trans-10,trans-12-octadecadienoic acid | |
| |
| Formula | C18H32O3 |
| Exact Mass | 296.23514489 |
| Average Mass | 296.44488 |
| SMILES | CCCCCC=CC=CC(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| / Smith_CR_Jr et al./ | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
