LBF18206SC02: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030111 | |LipidMaps=LMFA01030111 | ||
|SysName=cis-5, trans-12-Octadecadienoic acid | |SysName=cis-5, trans-12-Octadecadienoic acid | ||
|Common Name=&&cis-5, trans-12-Octadecadienoic acid&& | |||
|Melting Point=-4 to -2°C | |Melting Point=-4 to -2°C | ||
|Optical=1.4677 at 20°C | |Optical=1.4677 at 20°C | ||
|Solubility= | |Solubility= | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0150 |
| LipidMaps | LMFA01030111 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18206SC02 |
| cis-5, trans-12-Octadecadienoic acid | |
|---|---|
| |
| Structural Information | |
| cis-5, trans-12-Octadecadienoic acid | |
| |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCC=CCCCCCC=CCCCC(O)=O |
| Physicochemical Information | |
| -4 to -2°C | |
| 1.4677 at 20°C | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
