LBF18208SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 8: | Line 8: | ||
|Density=d<SUP><FONT SIZE=-1>6</FONT></SUP><SUP><FONT SIZE=-1>0</FONT></SUP><SUB><FONT SIZE=-1>4</FONT></SUB> 0.8808 | |Density=d<SUP><FONT SIZE=-1>6</FONT></SUP><SUP><FONT SIZE=-1>0</FONT></SUP><SUB><FONT SIZE=-1>4</FONT></SUB> 0.8808 | ||
|Optical=1.4682 at 60°C | |Optical=1.4682 at 60°C | ||
|Solubility= | |Solubility= | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0154 |
| LipidMaps | LMFA01030115 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18208SC01 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| trans-8, trans-10-Octadecadienoic acid | |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCCCC=CC=CCCCCCCC(O)=O |
| Physicochemical Information | |
| 56°C to 56.5°C | |
| d604 0.8808 | |
| 1.4682 at 60°C | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
