LBF18305SC02: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030147 | |LipidMaps=LMFA01030147 | ||
|SysName=cis-9, trans-11, trans-13-Octadecatrienoic acid | |SysName=cis-9, trans-11, trans-13-Octadecatrienoic acid | ||
|Common Name=&&alpha-Eleostearic acid&& | |Common Name=&&alpha-Eleostearic acid&&cis-9, trans-11, trans-13-Octadecatrienoic acid&& | ||
|Melting Point=49-49.2°C | |Melting Point=49-49.2°C | ||
|Boiling Point=235°C at 15 mmHg | |Boiling Point=235°C at 15 mmHg | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0186 |
| LipidMaps | LMFA01030147 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18305SC02 |
| α-Eleostearic acid | |
|---|---|
| |
| Structural Information | |
| cis-9, trans-11, trans-13-Octadecatrienoic acid | |
| |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCC=CC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 49-49.2°C | |
| 235°C at 15 mmHg | |
| d504 0.9028 | |
| 1.5112 at 50°C | |
| soluble in ethanol, cyclohexane and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
