LBF18305SC04: Difference between revisions
No edit summary |
No edit summary |
||
| Line 10: | Line 10: | ||
|Density=dX<sub>4</sub><sup>75</sup> 0.8909 | |Density=dX<sub>4</sub><sup>75</sup> 0.8909 | ||
|Optical=1.5011 at 75°C | |Optical=1.5011 at 75°C | ||
|Solubility=soluble in ethanol, methylalcohol and petroleum ether. | |Solubility=soluble in ethanol, methylalcohol and petroleum ether. | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0188 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18305SC04 |
| β-Eleostearic acid | |
|---|---|
| |
| Structural Information | |
| trans-9, trans-11, trans-13-Octadecatrienoic acid | |
| |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCC=CC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 71-71.5°C | |
| 188°C at 1 mmHg | |
| dX475 0.8909 | |
| 1.5011 at 75°C | |
| soluble in ethanol, methylalcohol and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
