LBF19109XX01: Difference between revisions
m (LBF192nnXX01 moved to LBF19109XX01) |
m (LBF192nnXX01 moved to LBF19109XX01) |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030190 | |LipidMaps=LMFA01030190 | ||
|SysName=omega- (2-n-Octylcycloprop-1-enyl) octanoic acid | |SysName=omega- (2-n-Octylcycloprop-1-enyl) octanoic acid | ||
|Common Name=&&Sterculic acid&& | |Common Name=&&Sterculic acid&&omega- (2-n-Octylcycloprop-1-enyl) octanoic acid&& | ||
|Melting Point=18 °C | |Melting Point=18 °C | ||
|Solubility=soluble in ether. | |Solubility=soluble in ether. | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0261 |
| LipidMaps | LMFA01030190 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF19109XX01 |
| Sterculic acid | |
|---|---|
| |
| Structural Information | |
| ω- (2-n-Octylcycloprop-1-enyl) octanoic acid | |
| |
| Formula | C19H34O2 |
| Exact Mass | 294.255880332 |
| Average Mass | 294.47206000000006 |
| SMILES | C(=C(CCCCCCCC(O)=O)1)(CCCCCCCC)C1 |
| Physicochemical Information | |
| 18 °C | |
| soluble in ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
