LBF20207PG34: Difference between revisions
m (LBF20307PG19 moved to LBF20207PG34) |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA03010060 | |LipidMaps=LMFA03010060 | ||
|SysName= 9-oxo-11beta,15S-dihydroxy-prosta-5Z,13E-dien-1-oic acid | |SysName= 9-oxo-11beta,15S-dihydroxy-prosta-5Z,13E-dien-1-oic acid | ||
|Common Name=&&11beta-Prostaglandin | |Common Name=&&11beta-Prostaglandin E_2&& | ||
}} | }} | ||
Revision as of 07:31, 19 December 2008
| IDs and Links | |
|---|---|
| LipidBank | XPR1742 |
| LipidMaps | LMFA03010060 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20207PG34 |
| 11β-Prostaglandin E2 | |
|---|---|
| |
| Structural Information | |
| 9-oxo-11β,15S-dihydroxy-prosta-5Z,13E-dien-1-oic acid | |
| |
| Formula | C20H32O5 |
| Exact Mass | 352.224974134 |
| Average Mass | 352.46508 |
| SMILES | C(CC[C@@H](O)C=C[C@H]([C@H]1CC=CCCCC(O)=O)[C@H](CC1=O)O)CC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
