LBF20404SC01: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 00:03, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0212 |
| LipidMaps | LMFA01030173 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF20404SC01 |
| 4, 8, 12, 16-Eicosatetraenoic acid | |
|---|---|
| |
| Structural Information | |
| 4, 8, 12, 16-Eicosatetraenoic acid / 4, 8, 12, 16-icosatetraenoic acid | |
| |
| Formula | C20H32O2 |
| Exact Mass | 304.240230268 |
| Average Mass | 304.46688 |
| SMILES | C(=CCCC=CCCC=CCCC=CCCC(O)=O)CCC |
| Physicochemical Information | |
| 217 to 220 °C at 20 mmHg | |
| 0.9263 at 20 °C | |
| 1.4915 at 20 °C | |
| soluble in acetone, methyl alcohol, ether and petroleum ether. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
