LBF24109SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 8: | Line 8: | ||
|Melting Point=42.5-43°C | |Melting Point=42.5-43°C | ||
|Solubility=soluble in acetone, ethanol and ether <<0092>> <<0210>> <<0290>> <<0503>> <<0504>> <<0506>> | |Solubility=soluble in acetone, ethanol and ether <<0092>> <<0210>> <<0290>> <<0503>> <<0504>> <<0506>> | ||
|Mass Spectra={{Image200| | |Mass Spectra={{Image200|LBF24109SC01SP0001.gif}} (provided by Dr. Takeshi Kasama). | ||
|Chromatograms=Gas liquid chromatogram {{Image200| | |Chromatograms=Gas liquid chromatogram {{Image200|LBF24109SC01CH0001.gif}}{{Image200|LBF24109SC01CH0002.gif}} (provided by Dr. Akiko Horiuchi). | ||
}} | }} | ||
Revision as of 06:22, 5 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0131 |
| LipidMaps | LMFA01030092 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF24109SC01 |
| Nervonic acid | |
|---|---|
| |
| Structural Information | |
| cis-15-Tetracosenoic acid | |
| |
| Formula | C24H46O2 |
| Exact Mass | 366.349780716 |
| Average Mass | 366.62084 |
| SMILES | C(CCCCC(O)=O)CCCCCCCCC=CCCCCCCCC |
| Physicochemical Information | |
| 42.5-43°C | |
| soluble in acetone, ethanol and ether <<0092>> <<0210>> <<0290>> <<0503>> <<0504>> <<0506>> | |
| Spectral Information | |
| Mass Spectra |  (provided by Dr. Takeshi Kasama). |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | Gas liquid chromatogram   (provided by Dr. Akiko Horiuchi). |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
