LBG00kck:18109SC01:CBZ1Sk013:R: Difference between revisions
No edit summary |
(No difference)
|
Revision as of 21:00, 8 July 2009
| IDs and Links | |
|---|---|
| LipidBank | PPA0061 |
| LipidMaps | [1] |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBG00kck:18109SC01:CBZ1Sk013:R |
| E | |
|---|---|
| |
| Structural Information | |
| 1-O- [ (Z) -9-Octadecenyl ] -2-O-benzoyl-3-O- [ (p-methoxyphenyl) diphenylmethyl ] -sn-glycerol | |
| |
| Formula | C49H64O5 |
| Exact Mass | 732.4753751579999 |
| Average Mass | 733.02946 |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC(OC(c(c4)cccc4)=O)(COC(c(c3)cccc3)(c(c2)cccc2)c(c1)ccc(c1)OC)C |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
