LBF20207PG66: Difference between revisions
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |LipidBank=XPR1744 |LipidMaps=LMFA03010062 |SysName= 9-Oxo-15R-hydroxy-16,16-dimethyl-prost- (5-cis,13-trans) -dien-1-oic acid |Common Name=&&11-de...) |
(No difference)
|
Revision as of 01:40, 16 September 2010
IDs and Links | |
---|---|
LipidBank | XPR1744 |
LipidMaps | LMFA03010062 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | {{{KNApSAcK}}} |
mol | LBF20207PG66 |
11-deoxy-16,16-dimethyl Prostaglandin E2 | |
---|---|
Structural Information | |
9-Oxo-15R-hydroxy-16,16-dimethyl-prost- (5-cis,13-trans) -dien-1-oic acid | |
| |
Formula | C22H36O4 |
Exact Mass | 364.26135963999997 |
Average Mass | 364.51884 |
SMILES | C(C(C)(C)[C@H](C=C[C@@H](C1)[C@@H](CC=CCCCC(O)=O)C(C1)=O)O)CCC |
Physicochemical Information | |
In rat, 11-deoxy-16,16-dimethyl Prostaglandin E2 inhibits secretion of gastric acid secretion so that suppresses ulcer formation. Lippmann_W 11-deoxy-16,16-dimethyl Prostaglandin E2 contracts human resporatory tract smooth muscle. Karim_SM et al. | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Other Spectra | |
Chromatograms |
Reported Metabolites, References | |||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|