LBF24109SC02: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030093 | |LipidMaps=LMFA01030093 | ||
|SysName=trans-15-Tetracosenoic acid | |SysName=trans-15-Tetracosenoic acid | ||
|Common Name=&&trans-Selacholeic acid&& | |Common Name=&&trans-Selacholeic acid&&trans-15-Tetracosenoic acid&& | ||
|Melting Point=65.5°C | |Melting Point=65.5°C | ||
|Solubility= | |Solubility= | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0132 |
| LipidMaps | LMFA01030093 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF24109SC02 |
| trans-Selacholeic acid | |
|---|---|
| |
| Structural Information | |
| trans-15-Tetracosenoic acid | |
| |
| Formula | C24H46O2 |
| Exact Mass | 366.349780716 |
| Average Mass | 366.62084 |
| SMILES | C(CCCCC(O)=O)CCCCCCCCC=CCCCCCCCC |
| Physicochemical Information | |
| 65.5°C | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
