LBGPxkkp:16402BC01:16402BC01:R: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 21:00, 8 July 2009
| IDs and Links | |
|---|---|
| LipidBank | EEL0221 |
| LipidMaps | [1] |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBGPxkkp:16402BC01:16402BC01:R |
| 1,2-di-O- (3',7',11',15'-tetramethylhexadec-2',6',10',14'-tetraenyl) -3- (dimethylphospho) -sn-glycerol | |
|---|---|
| |
| Structural Information | |
| 1,2-di-O-geranylgeranyl-3- (dimethylphospho) -sn-glycerol | |
| |
| Formula | C52H101O6P |
| Exact Mass | 852.733577474 |
| Average Mass | 853.328501 |
| SMILES | CC(CCC=C(C)CCC=C(C)CCCC(C)(C)C)=CCOCC(OCC=C(C)CCC=C(C)CCC=C(CCC)C)([H])COP(OC)(OC)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
