LBGPxpkk:R:18109SC01:18109SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 2: | Line 2: | ||
|LipidBank=EEL0223 | |LipidBank=EEL0223 | ||
|SysName=2,3-di-O-oleyl-1- (dimethylphospho) -sn-glycerol | |SysName=2,3-di-O-oleyl-1- (dimethylphospho) -sn-glycerol | ||
|Common Name=&& | |Common Name=&&2,3-di-O- (9'-cis-octadecenyl) -1- (dimethylphospho) -sn-glycerol&&2,3-di-O-oleyl-1- (dimethylphospho) -sn-glycerol&& | ||
}} | }} | ||
Revision as of 20:00, 8 July 2009
| IDs and Links | |
|---|---|
| LipidBank | EEL0223 |
| LipidMaps | [1] |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBGPxpkk:R:18109SC01:18109SC01 |
| 2,3-di-O- (9'-cis-octadecenyl) -1- (dimethylphospho) -sn-glycerol | |
|---|---|
| |
| Structural Information | |
| 2,3-di-O-oleyl-1- (dimethylphospho) -sn-glycerol | |
| |
| Formula | C43H89O6P |
| Exact Mass | 732.6396770900001 |
| Average Mass | 733.136921 |
| SMILES | C(CCCCC)CCOC(COCCCCCCCC)([H])COP(=O)(OC)OC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
