LBF10000BC04: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01020173 | |LipidMaps=LMFA01020173 | ||
|SysName=2-Ethyl-2-Butyl Decanoic Acid | |SysName=2-Ethyl-2-Butyl Decanoic Acid | ||
|Boiling Point=138-139°C/0.4mmHg | |Boiling Point=138-139°C/0.4mmHg [[Reference:Hauser_CR:Chambers_WJ:,J. Am. Chem. Soc.,1956,78,3837|{{RelationTable/GetFirstAuthor|Reference:Hauser_CR:Chambers_WJ:,J. Am. Chem. Soc.,1956,78,3837}}]] | ||
|Optical=<FONT FACE="Symbol">h</FONT>25/D=1.4500 | |Optical=<FONT FACE="Symbol">h</FONT>25/D=1.4500[[Reference:Hauser_CR:Chambers_WJ:,J. Am. Chem. Soc.,1956,78,3837|{{RelationTable/GetFirstAuthor|Reference:Hauser_CR:Chambers_WJ:,J. Am. Chem. Soc.,1956,78,3837}}]] | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7141 |
| LipidMaps | LMFA01020173 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF10000BC04 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 2-Ethyl-2-Butyl Decanoic Acid | |
| Formula | C16H32O2 |
| Exact Mass | 256.240230268 |
| Average Mass | 256.42408 |
| SMILES | CCCCCCCCC(CC)(CCCC)C(O)=O |
| Physicochemical Information | |
| 138-139°C/0.4mmHg Hauser_CR et al. | |
| h25/D=1.4500 Hauser_CR et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
