LBF15000BC02: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01020040 | |LipidMaps=LMFA01020040 | ||
|SysName=2,6-Dimethylpentadecanoic Acid | |SysName=2,6-Dimethylpentadecanoic Acid | ||
|Mass Spectra={{Image200| | |Mass Spectra={{Image200|LBF15000BC02SP0001.gif}} (provided by Dr. Takeshi Kasama). | ||
}} | }} | ||
Revision as of 15:47, 5 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA7008 |
| LipidMaps | LMFA01020040 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF15000BC02 |
| GlcNAca/b1-3Xyla-4Galb1-3GalNAca1-4(NeuAc?1-2NeuGc4Mea1-3)GalNAcb1-4(EtnP-6)GlcNAcb1-3Manb1-4Glcb1-1Cer | |
|---|---|
| |
| Structural Information | |
| 2,6-Dimethylpentadecanoic Acid | |
| Formula | C17H34O2 |
| Exact Mass | 270.255880332 |
| Average Mass | 270.45065999999997 |
| SMILES | CCCCCCCCCC(C)CCCC(C)C(O)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | (provided by Dr. Takeshi Kasama). |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
