LBF16000HO10: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 09:02, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0367 |
| LipidMaps | LMFA01050101 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16000HO10 |
| 9,10,16-Trihydroxypalmitic acid | |
|---|---|
| |
| Structural Information | |
| 9,10,16-Trihydroxyhexadecanoic acid | |
| |
| Formula | C16H32O5 |
| Exact Mass | 304.224974134 |
| Average Mass | 304.42228 |
| SMILES | OCCCCCCC(O)C(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| 102°C/104°C | |
| soluble in aqueous alcohol, methyl alcohol, ; needles from water. /// | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
