LBF16000HO11: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&11,12,15-Trihydroxypalmitic acid&& | |Common Name=&&11,12,15-Trihydroxypalmitic acid&& | ||
|Melting Point=100°C | |Melting Point=100°C | ||
|Solubility= | |Solubility=/[[Reference:Davies_LA:Gardner_WH:,J. Am. Chem. Soc.,1942,,|{{RelationTable/GetFirstAuthor|Reference:Davies_LA:Gardner_WH:,J. Am. Chem. Soc.,1942,,}}]] | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0368 |
| LipidMaps | LMFA01050102 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16000HO11 |
| 11,12,15-Trihydroxypalmitic acid | |
|---|---|
| |
| Structural Information | |
| 11,12,15-Trihydroxyhexadecanoic acid | |
| |
| Formula | C16H32O5 |
| Exact Mass | 304.224974134 |
| Average Mass | 304.42228 |
| SMILES | CC(O)CCC(O)C(O)CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| 100°C | |
| / Davies_LA et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
