LBF16000OX07: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&9-Ketopalmitic acid&& | |Common Name=&&9-Ketopalmitic acid&& | ||
|Melting Point=73.5-74.5°C | |Melting Point=73.5-74.5°C | ||
|Solubility= | |Solubility=[[Reference:Davies_LA:Adams_R:,J. Am. Chem. Soc.,1928,50,1749|{{RelationTable/GetFirstAuthor|Reference:Davies_LA:Adams_R:,J. Am. Chem. Soc.,1928,50,1749}}]] | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0440 |
| LipidMaps | LMFA01060056 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF16000OX07 |
| 9-Ketopalmitic acid | |
|---|---|
| |
| Structural Information | |
| 9-Oxohexadecanoic acid | |
| |
| Formula | C16H30O3 |
| Exact Mass | 270.21949482599996 |
| Average Mass | 270.4076 |
| SMILES | CCCCCCCC(=O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| 73.5-74.5°C | |
| Davies_LA et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
