LBF18000HO23: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01050090 | |LipidMaps=LMFA01050090 | ||
|SysName=9,10-Dihydroxyoctadecanoic acid | |SysName=9,10-Dihydroxyoctadecanoic acid | ||
|Common Name=&&9,10-Dihydroxystearic acid&& | |Common Name=&&9,10-Dihydroxystearic acid&&9,10-Dihydroxyoctadecanoic acid&& | ||
|Melting Point=133-136.5°C (erythro) | |Melting Point=133-136.5°C (erythro) | ||
|Solubility=soluble in alcohol, ethanol, hot water, methanol and alcohol[[Reference:Smith_CR_Jr:Bagby_MO:Lohmar_RL:Glass_CA:Wolff_A:,J. Org. Chem.,1960,25,218|{{RelationTable/GetFirstAuthor|Reference:Smith_CR_Jr:Bagby_MO:Lohmar_RL:Glass_CA:Wolff_A:,J. Org. Chem.,1960,25,218}}]] | |Solubility=soluble in alcohol, ethanol, hot water, methanol and alcohol[[Reference:Smith_CR_Jr:Bagby_MO:Lohmar_RL:Glass_CA:Wolff_A:,J. Org. Chem.,1960,25,218|{{RelationTable/GetFirstAuthor|Reference:Smith_CR_Jr:Bagby_MO:Lohmar_RL:Glass_CA:Wolff_A:,J. Org. Chem.,1960,25,218}}]] | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0356 |
| LipidMaps | LMFA01050090 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18000HO23 |
| 9,10-Dihydroxystearic acid | |
|---|---|
| |
| Structural Information | |
| 9,10-Dihydroxyoctadecanoic acid | |
| |
| Formula | C18H36O4 |
| Exact Mass | 316.26135963999997 |
| Average Mass | 316.47604 |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| 133-136.5°C (erythro) | |
| soluble in alcohol, ethanol, hot water, methanol and alcohol Smith_CR_Jr et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
