LBF18000HO26: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01050093 | |LipidMaps=LMFA01050093 | ||
|SysName=11,12-Dihydroxyoctadecanoic acid | |SysName=11,12-Dihydroxyoctadecanoic acid | ||
|Common Name=&&11,12-Dihydroxystearic acid&& | |Common Name=&&11,12-Dihydroxystearic acid&&11,12-Dihydroxyoctadecanoic acid&& | ||
|Melting Point=129-130°C (erythro), 95-96°C (threo) | |Melting Point=129-130°C (erythro), 95-96°C (threo) | ||
|Solubility=soluble in methanol and alcohol | |Solubility=soluble in methanol and alcohol | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0359 |
| LipidMaps | LMFA01050093 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18000HO26 |
| 11,12-Dihydroxystearic acid | |
|---|---|
| |
| Structural Information | |
| 11,12-Dihydroxyoctadecanoic acid | |
| |
| Formula | C18H36O4 |
| Exact Mass | 316.26135963999997 |
| Average Mass | 316.47604 |
| SMILES | CCCCCCC(O)C(O)CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| 129-130°C (erythro), 95-96°C (threo) | |
| soluble in methanol and alcohol | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
