LBF18000HO28: Difference between revisions
No edit summary |
No edit summary |
||
| Line 7: | Line 7: | ||
|Common Name=&&Phloionolic acid&& | |Common Name=&&Phloionolic acid&& | ||
|Melting Point=104°C | |Melting Point=104°C | ||
|Solubility= | |Solubility=[[Reference:Zetzsche_F:Sonderegger_G:,Helv. Chim. Acta,1931,14,632|{{RelationTable/GetFirstAuthor|Reference:Zetzsche_F:Sonderegger_G:,Helv. Chim. Acta,1931,14,632}}]] | ||
}} | }} | ||
Revision as of 00:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0369 |
| LipidMaps | LMFA01050103 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18000HO28 |
| Phloionolic acid | |
|---|---|
| |
| Structural Information | |
| 9,10,18-Trihydroxyoctadecanoic acid | |
| |
| Formula | C18H36O5 |
| Exact Mass | 332.256274262 |
| Average Mass | 332.47544 |
| SMILES | OCCCCCCCCC(O)C(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| 104°C | |
| ZetzscheFet al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
