LBF18000HO29: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01050105 | |LipidMaps=LMFA01050105 | ||
|SysName=9,10-threo-12,13-threo-Tetrahydroxyoctadecanoic acid | |SysName=9,10-threo-12,13-threo-Tetrahydroxyoctadecanoic acid | ||
|Common Name=&&Sativic acid&& | |Common Name=&&Sativic acid&&9,10-threo-12,13-threo-Tetrahydroxyoctadecanoic acid&& | ||
|Melting Point=147.5°C/148°C | |Melting Point=147.5°C/148°C | ||
|Solubility=/[[Reference:Birosel_DM:,J. Am. Chem. Soc.,1937,59,689|{{RelationTable/GetFirstAuthor|Reference:Birosel_DM:,J. Am. Chem. Soc.,1937,59,689}}]] | |Solubility=/[[Reference:Birosel_DM:,J. Am. Chem. Soc.,1937,59,689|{{RelationTable/GetFirstAuthor|Reference:Birosel_DM:,J. Am. Chem. Soc.,1937,59,689}}]] | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0371 |
| LipidMaps | LMFA01050105 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18000HO29 |
| Sativic acid | |
|---|---|
| |
| Structural Information | |
| 9,10-threo-12,13-threo-Tetrahydroxyoctadecanoic acid | |
| |
| Formula | C18H36O6 |
| Exact Mass | 348.251188884 |
| Average Mass | 348.47484 |
| SMILES | CCCCCC(O)C(O)CC(O)C(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| 147.5°C/148°C | |
| / Birosel_DM | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
