LBF18107HO02: Difference between revisions
No edit summary |
No edit summary |
||
(No difference)
| |||
Revision as of 09:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8021 |
| LipidMaps | LMFA01050123 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18107HO02 |
| 13-Hydroperoxy-9,10-Dihydroxy-11-Octadecenoic Acid | |
|---|---|
| |
| Structural Information | |
| 13-Hydroperoxy-9,10-Dihydroxy-11-Octadecenoic Acid | |
| |
| Formula | C18H34O6 |
| Exact Mass | 346.23553882 |
| Average Mass | 346.45896 |
| SMILES | CCCCCC(OO)C=CC(O)C(O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after methanolysis, reduction and trimethylsilylation), GC-EI-MS(aftre methanolysis, reduction, hydrogenation and trimethylsilylation ) StreckertGet al. |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
