LBF18109HO04: Difference between revisions
No edit summary |
No edit summary |
||
(No difference)
| |||
Revision as of 09:02, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8027 |
| LipidMaps | LMFA01050129 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18109HO04 |
| 12,13-Dihydroxy-9-Octadecenoic Acid | |
|---|---|
| |
| Structural Information | |
| 12,13-Dihydroxy-9-Octadecenoic Acid | |
| |
| Formula | C18H34O4 |
| Exact Mass | 314.24570957599997 |
| Average Mass | 314.46016 |
| SMILES | CCCCCC(O)C(O)CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation) StreckertGet al. Sessa_DJ et al.: m/e=457[M-CH3], 441[M-OCH3], 382[M-HOTMS], 299[M-173], 275[SMTO=CH-CH(OTMS)-(CH2)4CH3], 185[275-HOTMS], 173[SMTO=CH-( CH2)4CH3],GC-EI-MS(after methanolysis, hydrogenation and trimethylsilylation) StreckertGet al. |
| UV Spectra | |
| IR Spectra | Methyl ester Sessa_DJ et al. |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
