LBF18203HP03: Difference between revisions
No edit summary |
No edit summary |
(No difference)
| |
Revision as of 09:02, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA8059 |
| LipidMaps | LMFA01040043 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18203HP03 |
| Methyl-13,15-Epidioxy-12-Hydroperoxy-9,16-Octadecadienoate | |
|---|---|
| |
| Structural Information | |
| Methyl-13,15-Epidioxy-12-Hydroperoxy-9,16-Octadecadienoate | |
| |
| Formula | C19H32O6 |
| Exact Mass | 356.219888756 |
| Average Mass | 356.45378 |
| SMILES | C(O1)(CC(C=CC)O1)C(OO)CC=CCCCCCCCC(=O)OC |
| Physicochemical Information | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after reduction(PH3P) and TMS-derivatization) Neff_WE et al.: m/e=307[M-CH3- HOTMS]; 299[SMTO=CHCH2CH=CH(CH2)7COOCH3]; 113[M-299]; GC-EI-MS(after reduction, hydrogenation and TMS-derivatization) Neff_WE et al.: m/e=457[M-CH3-HOTMS] |
| UV Spectra | |
| IR Spectra | OOH GROUP: 3660-3150cm-1[bonded], 3520cm-1[free]; olefinic protons: 3020-3002cm-1; isolated trans unsaturation: 960cm-1 Neff_WE et al. |
| NMR Spectra | 1H-NMR Neff_WE et al. |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
