LBF18303SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 11: | Line 11: | ||
|Optical=1.4678 at 50°C | |Optical=1.4678 at 50°C | ||
|Solubility=soluble in acetone, ethanol, ether and petroleum ether.<<0400>> | |Solubility=soluble in acetone, ethanol, ether and petroleum ether.<<0400>> | ||
|Chromatograms=Gas liquid chromatogram {{Image200| | |Chromatograms=Gas liquid chromatogram {{Image200|LBF18303SC01CH0001.gif}} (provided by Dr. Akiko Horiuchi). | ||
}} | }} | ||
Revision as of 15:23, 5 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0191 |
| LipidMaps | LMFA01030152 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18303SC01 |
| α-Linolenic acid | |
|---|---|
| |
| Structural Information | |
| cis-9, cis-12, cis-15-Octadecatrienoic acid | |
| |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| -11.3 to -11°C | |
| 125°C at 0.05 mmHg | |
| dX420 0.9164 | |
| 1.4678 at 50°C | |
| soluble in acetone, ethanol, ether and petroleum ether.<<0400>> | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | Gas liquid chromatogram (provided by Dr. Akiko Horiuchi). |
| Reported Metabolites, References | |||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
