LBF18305SC01: Difference between revisions
No edit summary |
No edit summary |
||
| Line 9: | Line 9: | ||
|Density=d<SUP><FONT SIZE=-1>5</FONT></SUP><SUP><FONT SIZE=-1>0</FONT></SUP><SUB><FONT SIZE=-1>4</FONT></SUB> 0.9025 | |Density=d<SUP><FONT SIZE=-1>5</FONT></SUP><SUP><FONT SIZE=-1>0</FONT></SUP><SUB><FONT SIZE=-1>4</FONT></SUB> 0.9025 | ||
|Optical=1.5113 at 50°C | |Optical=1.5113 at 50°C | ||
|Solubility=soluble in ethanol, pentane and petroleum ether. | |Solubility=soluble in ethanol, pentane and petroleum ether.[[Reference:Chisholm_MJ:Hopkins_CY:,J. Org. Chem.,1962,27,3137|{{RelationTable/GetFirstAuthor|Reference:Chisholm_MJ:Hopkins_CY:,J. Org. Chem.,1962,27,3137}}]] | ||
}} | }} | ||
Revision as of 09:00, 12 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0185 |
| LipidMaps | LMFA01030146 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18305SC01 |
| Punicic acid | |
|---|---|
| |
| Structural Information | |
| cis-9, trans-11, cis-13-Octadecatrienoic acid | |
| |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCC=CC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 43.5-44°C | |
| d504 0.9025 | |
| 1.5113 at 50°C | |
| soluble in ethanol, pentane and petroleum ether. Chisholm_MJ et al. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
