LBF18305SC03: Difference between revisions
No edit summary |
No edit summary |
||
| Line 5: | Line 5: | ||
|LipidMaps=LMFA01030148 | |LipidMaps=LMFA01030148 | ||
|SysName=trans-9, trans-11, trans-13-Octadecatrienoic acid | |SysName=trans-9, trans-11, trans-13-Octadecatrienoic acid | ||
|Common Name=&&trans-9, trans-11, trans-13-Octadecatrienoic acid&& | |||
|Melting Point=61.5-62.5°C | |Melting Point=61.5-62.5°C | ||
|Solubility=soluble in acetone, ethanol, CS<SUB><FONT SIZE=-1>2</FONT></SUB>, heptane, methylalcohol and pentane. | |Solubility=soluble in acetone, ethanol, CS<SUB><FONT SIZE=-1>2</FONT></SUB>, heptane, methylalcohol and pentane. | ||
}} | }} | ||
Revision as of 00:01, 20 December 2008
| IDs and Links | |
|---|---|
| LipidBank | DFA0187 |
| LipidMaps | LMFA01030148 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | {{{KNApSAcK}}} |
| mol | LBF18305SC03 |
| trans-9, trans-11, trans-13-Octadecatrienoic acid | |
|---|---|
| |
| Structural Information | |
| trans-9, trans-11, trans-13-Octadecatrienoic acid | |
| |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCC=CC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| 61.5-62.5°C | |
| soluble in acetone, ethanol, CS2, heptane, methylalcohol and pentane. | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Other Spectra | |
| Chromatograms | |
| Reported Metabolites, References | ||||||||||
|---|---|---|---|---|---|---|---|---|---|---|
|
